commit 8b9add004b436ccbfbc3ce3f31d874c5f2137f8c
Author: RemRem <remrem@github.com>
Date:   Mon Nov 6 10:21:46 2023 +0100

    init

diff --git a/.coveralls.yml b/.coveralls.yml
new file mode 100644
index 0000000..a8172fe
--- /dev/null
+++ b/.coveralls.yml
@@ -0,0 +1 @@
+json_path: coveralls-upload.json
diff --git a/.gitignore b/.gitignore
new file mode 100644
index 0000000..378a482
--- /dev/null
+++ b/.gitignore
@@ -0,0 +1,8 @@
+.idea/
+.vscode/
+/coverage/
+/vendor/
+/var/
+/logs/*
+!/logs/README.md
+.phpunit.result.cache
diff --git a/.htaccess b/.htaccess
new file mode 100644
index 0000000..c7552bf
--- /dev/null
+++ b/.htaccess
@@ -0,0 +1,19 @@
+Options All -Indexes
+
+<Files .htaccess>
+order allow,deny
+deny from all
+</Files>
+
+<IfModule mod_rewrite.c>
+  # Redirect to the public folder
+  RewriteEngine On
+  # RewriteBase /
+  RewriteRule ^$ public/ [L]
+  RewriteRule (.*) public/$1 [L]
+
+  # Redirect to HTTPS
+  # RewriteEngine On
+  # RewriteCond %{HTTPS} off
+  # RewriteRule ^(.*)$ https://%{HTTP_HOST}%{REQUEST_URI} [L,R=301]
+</IfModule>
diff --git a/README.md b/README.md
new file mode 100644
index 0000000..63f9972
--- /dev/null
+++ b/README.md
@@ -0,0 +1,42 @@
+# Slim Framework 4 Skeleton Application
+
+[![Coverage Status](https://coveralls.io/repos/github/slimphp/Slim-Skeleton/badge.svg?branch=master)](https://coveralls.io/github/slimphp/Slim-Skeleton?branch=master)
+
+Use this skeleton application to quickly setup and start working on a new Slim Framework 4 application. This application uses the latest Slim 4 with Slim PSR-7 implementation and PHP-DI container implementation. It also uses the Monolog logger.
+
+This skeleton application was built for Composer. This makes setting up a new Slim Framework application quick and easy.
+
+## Install the Application
+
+Run this command from the directory in which you want to install your new Slim Framework application. You will require PHP 7.4 or newer.
+
+```bash
+composer create-project slim/slim-skeleton [my-app-name]
+```
+
+Replace `[my-app-name]` with the desired directory name for your new application. You'll want to:
+
+* Point your virtual host document root to your new application's `public/` directory.
+* Ensure `logs/` is web writable.
+
+To run the application in development, you can run these commands 
+
+```bash
+cd [my-app-name]
+composer start
+```
+
+Or you can use `docker-compose` to run the app with `docker`, so you can run these commands:
+```bash
+cd [my-app-name]
+docker-compose up -d
+```
+After that, open `http://localhost:8080` in your browser.
+
+Run this command in the application directory to run the test suite
+
+```bash
+composer test
+```
+
+That's it! Now go build something cool.
diff --git a/app/dependencies.php b/app/dependencies.php
new file mode 100644
index 0000000..fd3f066
--- /dev/null
+++ b/app/dependencies.php
@@ -0,0 +1,30 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Application\Settings\SettingsInterface;
+use DI\ContainerBuilder;
+use Monolog\Handler\StreamHandler;
+use Monolog\Logger;
+use Monolog\Processor\UidProcessor;
+use Psr\Container\ContainerInterface;
+use Psr\Log\LoggerInterface;
+
+return function (ContainerBuilder $containerBuilder) {
+    $containerBuilder->addDefinitions([
+        LoggerInterface::class => function (ContainerInterface $c) {
+            $settings = $c->get(SettingsInterface::class);
+
+            $loggerSettings = $settings->get('logger');
+            $logger = new Logger($loggerSettings['name']);
+
+            $processor = new UidProcessor();
+            $logger->pushProcessor($processor);
+
+            $handler = new StreamHandler($loggerSettings['path'], $loggerSettings['level']);
+            $logger->pushHandler($handler);
+
+            return $logger;
+        },
+    ]);
+};
diff --git a/app/middleware.php b/app/middleware.php
new file mode 100644
index 0000000..db91c39
--- /dev/null
+++ b/app/middleware.php
@@ -0,0 +1,11 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Application\Middleware\SessionMiddleware;
+use Slim\App;
+
+return function (App $app) {
+    $app->add(SessionMiddleware::class);
+    $app->addBodyParsingMiddleware();
+};
diff --git a/app/repositories.php b/app/repositories.php
new file mode 100644
index 0000000..15f20f3
--- /dev/null
+++ b/app/repositories.php
@@ -0,0 +1,14 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Domain\User\UserRepository;
+use App\Infrastructure\Persistence\User\InMemoryUserRepository;
+use DI\ContainerBuilder;
+
+return function (ContainerBuilder $containerBuilder) {
+    // Here we map our UserRepository interface to its in memory implementation
+    $containerBuilder->addDefinitions([
+        UserRepository::class => \DI\autowire(InMemoryUserRepository::class),
+    ]);
+};
diff --git a/app/routes.php b/app/routes.php
new file mode 100644
index 0000000..cc84b83
--- /dev/null
+++ b/app/routes.php
@@ -0,0 +1,93 @@
+<?php
+
+declare(strict_types=1);
+
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\App;
+
+return function (App $app) {
+
+    $app->get('/', function (Request $req, Response $res) {
+        $res->getBody()->write('SmartFit-API is working!');
+        return $res;
+    });
+    
+    #### ACCOUNT ####
+    // Create User 
+    $app->post('/user', function (Request $req, Response $res) {
+        $res->getBody()->write('/user');
+        return $res;
+    });
+
+    // Delete User 
+    $app->delete('/user', function (Request $req, Response $res) {
+        $token = $req->getHeader('Authorization')[0];
+        
+        $res->getBody()->write('/user/' . $token);
+        return $res;
+    });
+
+    // Get Token
+    $app->get('/user/{uuid}/{hash}/token', function (Request $req, Response $res, $args) {
+        $uuid = $args['uuid'];
+        $hash = $args['hash'];
+        
+        $res->getBody()->write('/user/' . $uuid . '/' . $hash);
+        return $res;
+    });
+
+    // Update Mail
+    $app->put('/user/mail', function(Request $req, Response $res) {
+        $token = $req->getHeader('Authorization')[0];
+        $mail = $req->getParsedBody()['mail'];
+
+        $res->getBody()->write('/user/mail mail:'.$mail.' Auth:'.$token);
+        return $res; 
+    });
+
+    // Update Username
+    $app->put('/user/username', function(Request $req, Response $res) {
+        $token = $req->getHeader('Authorization')[0];
+        $username = $req->getParsedBody()['username'];
+
+        $res->getBody()->write('/user/username username:'.$username.' Auth:'.$token);
+        return $res; 
+    });
+
+    #### FILES ####
+    // Get list of files 
+    $app->get('/user/files', function (Request $req, Response $res) {
+        $token = $req->getHeader('Authorization')[0];
+        
+        $res->getBody()->write('/user/files' . ' Auth:' . $token);
+        return $res;
+    });
+
+    // Get file 
+    $app->get('/user/files/{uuid}', function (Request $req, Response $res, $args) {
+        $token = $req->getHeader('Authorization')[0];
+        $uuid = $args['uuid'];
+        
+        $res->getBody()->write('/user/files/'.$uuid.' Auth:'.$token);
+        return $res;
+    });
+    
+    // Delete file
+    $app->delete('/user/files/{uuid}', function (Request $req, Response $res, $args) {
+        $token = $req->getHeader('Authorization')[0];
+        $uuid = $args['uuid'];
+
+        $res->getBody()->write('/user/files/'.$uuid.' Auth:'.$token);
+        return $res;
+    });
+    
+    // Upload file 
+    $app->post('/user/files', function (Request $req, Response $res) {
+        $token = $req->getHeader('Authorization')[0];
+        
+        $res->getBody()->write('/user/files'.' Auth:'.$token);
+        return $res;
+    });
+
+};
\ No newline at end of file
diff --git a/app/settings.php b/app/settings.php
new file mode 100644
index 0000000..79392bd
--- /dev/null
+++ b/app/settings.php
@@ -0,0 +1,27 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Application\Settings\Settings;
+use App\Application\Settings\SettingsInterface;
+use DI\ContainerBuilder;
+use Monolog\Logger;
+
+return function (ContainerBuilder $containerBuilder) {
+
+    // Global Settings Object
+    $containerBuilder->addDefinitions([
+        SettingsInterface::class => function () {
+            return new Settings([
+                'displayErrorDetails' => true, // Should be set to false in production
+                'logError'            => false,
+                'logErrorDetails'     => false,
+                'logger' => [
+                    'name' => 'slim-app',
+                    'path' => isset($_ENV['docker']) ? 'php://stdout' : __DIR__ . '/../logs/app.log',
+                    'level' => Logger::DEBUG,
+                ],
+            ]);
+        }
+    ]);
+};
diff --git a/composer.json b/composer.json
new file mode 100644
index 0000000..6b8de2a
--- /dev/null
+++ b/composer.json
@@ -0,0 +1,61 @@
+{
+    "name": "slim/slim-skeleton",
+    "description": "A Slim Framework skeleton application for rapid development",
+    "keywords": [
+        "microframework",
+        "rest",
+        "router",
+        "psr7"
+    ],
+    "homepage": "http://github.com/slimphp/Slim-Skeleton",
+    "license": "MIT",
+    "authors": [
+        {
+            "name": "Josh Lockhart",
+            "email": "info@joshlockhart.com",
+            "homepage": "http://www.joshlockhart.com/"
+        },
+        {
+            "name": "Pierre Berube",
+            "email": "pierre@lgse.com",
+            "homepage": "http://www.lgse.com/"
+        }
+    ],
+    "require": {
+        "php": "^7.4 || ^8.0",
+        "ext-json": "*",
+        "monolog/monolog": "^2.8",
+        "php-di/php-di": "^6.4",
+        "slim/psr7": "^1.5",
+        "slim/slim": "^4.10"
+    },
+    "require-dev": {
+        "jangregor/phpstan-prophecy": "^1.0.0",
+        "phpspec/prophecy-phpunit": "^2.0",
+        "phpstan/extension-installer": "^1.2.0",
+        "phpstan/phpstan": "^1.8",
+        "phpunit/phpunit": "^9.5.26",
+        "squizlabs/php_codesniffer": "^3.7"
+    },
+    "config": {
+        "allow-plugins": {
+            "phpstan/extension-installer": true
+        },
+        "process-timeout": 0,
+        "sort-packages": true
+    },
+    "autoload": {
+        "psr-4": {
+            "App\\": "src/"
+        }
+    },
+    "autoload-dev": {
+        "psr-4": {
+            "Tests\\": "tests/"
+        }
+    },
+    "scripts": {
+        "start": "php -S localhost:8080 -t public",
+        "test": "phpunit"
+    }
+}
diff --git a/composer.lock b/composer.lock
new file mode 100644
index 0000000..69ca691
--- /dev/null
+++ b/composer.lock
@@ -0,0 +1,3507 @@
+{
+    "_readme": [
+        "This file locks the dependencies of your project to a known state",
+        "Read more about it at https://getcomposer.org/doc/01-basic-usage.md#installing-dependencies",
+        "This file is @generated automatically"
+    ],
+    "content-hash": "62d60de4b802ec31b840b9197e947981",
+    "packages": [
+        {
+            "name": "fig/http-message-util",
+            "version": "1.1.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-message-util.git",
+                "reference": "9d94dc0154230ac39e5bf89398b324a86f63f765"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-message-util/zipball/9d94dc0154230ac39e5bf89398b324a86f63f765",
+                "reference": "9d94dc0154230ac39e5bf89398b324a86f63f765",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^5.3 || ^7.0 || ^8.0"
+            },
+            "suggest": {
+                "psr/http-message": "The package containing the PSR-7 interfaces"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Fig\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Utility classes and constants for use with PSR-7 (psr/http-message)",
+            "keywords": [
+                "http",
+                "http-message",
+                "psr",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/http-message-util/issues",
+                "source": "https://github.com/php-fig/http-message-util/tree/1.1.5"
+            },
+            "time": "2020-11-24T22:02:12+00:00"
+        },
+        {
+            "name": "laravel/serializable-closure",
+            "version": "v1.3.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/laravel/serializable-closure.git",
+                "reference": "076fe2cf128bd54b4341cdc6d49b95b34e101e4c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/laravel/serializable-closure/zipball/076fe2cf128bd54b4341cdc6d49b95b34e101e4c",
+                "reference": "076fe2cf128bd54b4341cdc6d49b95b34e101e4c",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.3|^8.0"
+            },
+            "require-dev": {
+                "nesbot/carbon": "^2.61",
+                "pestphp/pest": "^1.21.3",
+                "phpstan/phpstan": "^1.8.2",
+                "symfony/var-dumper": "^5.4.11"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Laravel\\SerializableClosure\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Taylor Otwell",
+                    "email": "taylor@laravel.com"
+                },
+                {
+                    "name": "Nuno Maduro",
+                    "email": "nuno@laravel.com"
+                }
+            ],
+            "description": "Laravel Serializable Closure provides an easy and secure way to serialize closures in PHP.",
+            "keywords": [
+                "closure",
+                "laravel",
+                "serializable"
+            ],
+            "support": {
+                "issues": "https://github.com/laravel/serializable-closure/issues",
+                "source": "https://github.com/laravel/serializable-closure"
+            },
+            "time": "2023-10-17T13:38:16+00:00"
+        },
+        {
+            "name": "monolog/monolog",
+            "version": "2.9.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Seldaek/monolog.git",
+                "reference": "f259e2b15fb95494c83f52d3caad003bbf5ffaa1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Seldaek/monolog/zipball/f259e2b15fb95494c83f52d3caad003bbf5ffaa1",
+                "reference": "f259e2b15fb95494c83f52d3caad003bbf5ffaa1",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2",
+                "psr/log": "^1.0.1 || ^2.0 || ^3.0"
+            },
+            "provide": {
+                "psr/log-implementation": "1.0.0 || 2.0.0 || 3.0.0"
+            },
+            "require-dev": {
+                "aws/aws-sdk-php": "^2.4.9 || ^3.0",
+                "doctrine/couchdb": "~1.0@dev",
+                "elasticsearch/elasticsearch": "^7 || ^8",
+                "ext-json": "*",
+                "graylog2/gelf-php": "^1.4.2 || ^2@dev",
+                "guzzlehttp/guzzle": "^7.4",
+                "guzzlehttp/psr7": "^2.2",
+                "mongodb/mongodb": "^1.8",
+                "php-amqplib/php-amqplib": "~2.4 || ^3",
+                "phpspec/prophecy": "^1.15",
+                "phpstan/phpstan": "^0.12.91",
+                "phpunit/phpunit": "^8.5.14",
+                "predis/predis": "^1.1 || ^2.0",
+                "rollbar/rollbar": "^1.3 || ^2 || ^3",
+                "ruflin/elastica": "^7",
+                "swiftmailer/swiftmailer": "^5.3|^6.0",
+                "symfony/mailer": "^5.4 || ^6",
+                "symfony/mime": "^5.4 || ^6"
+            },
+            "suggest": {
+                "aws/aws-sdk-php": "Allow sending log messages to AWS services like DynamoDB",
+                "doctrine/couchdb": "Allow sending log messages to a CouchDB server",
+                "elasticsearch/elasticsearch": "Allow sending log messages to an Elasticsearch server via official client",
+                "ext-amqp": "Allow sending log messages to an AMQP server (1.0+ required)",
+                "ext-curl": "Required to send log messages using the IFTTTHandler, the LogglyHandler, the SendGridHandler, the SlackWebhookHandler or the TelegramBotHandler",
+                "ext-mbstring": "Allow to work properly with unicode symbols",
+                "ext-mongodb": "Allow sending log messages to a MongoDB server (via driver)",
+                "ext-openssl": "Required to send log messages using SSL",
+                "ext-sockets": "Allow sending log messages to a Syslog server (via UDP driver)",
+                "graylog2/gelf-php": "Allow sending log messages to a GrayLog2 server",
+                "mongodb/mongodb": "Allow sending log messages to a MongoDB server (via library)",
+                "php-amqplib/php-amqplib": "Allow sending log messages to an AMQP server using php-amqplib",
+                "rollbar/rollbar": "Allow sending log messages to Rollbar",
+                "ruflin/elastica": "Allow sending log messages to an Elastic Search server"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Monolog\\": "src/Monolog"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jordi Boggiano",
+                    "email": "j.boggiano@seld.be",
+                    "homepage": "https://seld.be"
+                }
+            ],
+            "description": "Sends your logs to files, sockets, inboxes, databases and various web services",
+            "homepage": "https://github.com/Seldaek/monolog",
+            "keywords": [
+                "log",
+                "logging",
+                "psr-3"
+            ],
+            "support": {
+                "issues": "https://github.com/Seldaek/monolog/issues",
+                "source": "https://github.com/Seldaek/monolog/tree/2.9.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/Seldaek",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/monolog/monolog",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-02-06T13:44:46+00:00"
+        },
+        {
+            "name": "nikic/fast-route",
+            "version": "v1.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nikic/FastRoute.git",
+                "reference": "181d480e08d9476e61381e04a71b34dc0432e812"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nikic/FastRoute/zipball/181d480e08d9476e61381e04a71b34dc0432e812",
+                "reference": "181d480e08d9476e61381e04a71b34dc0432e812",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.4.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.8.35|~5.7"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/functions.php"
+                ],
+                "psr-4": {
+                    "FastRoute\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Nikita Popov",
+                    "email": "nikic@php.net"
+                }
+            ],
+            "description": "Fast request router for PHP",
+            "keywords": [
+                "router",
+                "routing"
+            ],
+            "support": {
+                "issues": "https://github.com/nikic/FastRoute/issues",
+                "source": "https://github.com/nikic/FastRoute/tree/master"
+            },
+            "time": "2018-02-13T20:26:39+00:00"
+        },
+        {
+            "name": "php-di/invoker",
+            "version": "2.3.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/PHP-DI/Invoker.git",
+                "reference": "33234b32dafa8eb69202f950a1fc92055ed76a86"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/PHP-DI/Invoker/zipball/33234b32dafa8eb69202f950a1fc92055ed76a86",
+                "reference": "33234b32dafa8eb69202f950a1fc92055ed76a86",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3",
+                "psr/container": "^1.0|^2.0"
+            },
+            "require-dev": {
+                "athletic/athletic": "~0.1.8",
+                "mnapoli/hard-mode": "~0.3.0",
+                "phpunit/phpunit": "^9.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Invoker\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Generic and extensible callable invoker",
+            "homepage": "https://github.com/PHP-DI/Invoker",
+            "keywords": [
+                "callable",
+                "dependency",
+                "dependency-injection",
+                "injection",
+                "invoke",
+                "invoker"
+            ],
+            "support": {
+                "issues": "https://github.com/PHP-DI/Invoker/issues",
+                "source": "https://github.com/PHP-DI/Invoker/tree/2.3.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/mnapoli",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-09-08T09:24:21+00:00"
+        },
+        {
+            "name": "php-di/php-di",
+            "version": "6.4.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/PHP-DI/PHP-DI.git",
+                "reference": "ae0f1b3b03d8b29dff81747063cbfd6276246cc4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/PHP-DI/PHP-DI/zipball/ae0f1b3b03d8b29dff81747063cbfd6276246cc4",
+                "reference": "ae0f1b3b03d8b29dff81747063cbfd6276246cc4",
+                "shasum": ""
+            },
+            "require": {
+                "laravel/serializable-closure": "^1.0",
+                "php": ">=7.4.0",
+                "php-di/invoker": "^2.0",
+                "php-di/phpdoc-reader": "^2.0.1",
+                "psr/container": "^1.0"
+            },
+            "provide": {
+                "psr/container-implementation": "^1.0"
+            },
+            "require-dev": {
+                "doctrine/annotations": "~1.10",
+                "friendsofphp/php-cs-fixer": "^2.4",
+                "mnapoli/phpunit-easymock": "^1.2",
+                "ocramius/proxy-manager": "^2.11.2",
+                "phpstan/phpstan": "^0.12",
+                "phpunit/phpunit": "^9.5"
+            },
+            "suggest": {
+                "doctrine/annotations": "Install it if you want to use annotations (version ~1.2)",
+                "ocramius/proxy-manager": "Install it if you want to use lazy injection (version ~2.0)"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/functions.php"
+                ],
+                "psr-4": {
+                    "DI\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "The dependency injection container for humans",
+            "homepage": "https://php-di.org/",
+            "keywords": [
+                "PSR-11",
+                "container",
+                "container-interop",
+                "dependency injection",
+                "di",
+                "ioc",
+                "psr11"
+            ],
+            "support": {
+                "issues": "https://github.com/PHP-DI/PHP-DI/issues",
+                "source": "https://github.com/PHP-DI/PHP-DI/tree/6.4.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/mnapoli",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/php-di/php-di",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-04-09T16:46:38+00:00"
+        },
+        {
+            "name": "php-di/phpdoc-reader",
+            "version": "2.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/PHP-DI/PhpDocReader.git",
+                "reference": "66daff34cbd2627740ffec9469ffbac9f8c8185c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/PHP-DI/PhpDocReader/zipball/66daff34cbd2627740ffec9469ffbac9f8c8185c",
+                "reference": "66daff34cbd2627740ffec9469ffbac9f8c8185c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.2.0"
+            },
+            "require-dev": {
+                "mnapoli/hard-mode": "~0.3.0",
+                "phpunit/phpunit": "^8.5|^9.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "PhpDocReader\\": "src/PhpDocReader"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "PhpDocReader parses @var and @param values in PHP docblocks (supports namespaced class names with the same resolution rules as PHP)",
+            "keywords": [
+                "phpdoc",
+                "reflection"
+            ],
+            "support": {
+                "issues": "https://github.com/PHP-DI/PhpDocReader/issues",
+                "source": "https://github.com/PHP-DI/PhpDocReader/tree/2.2.1"
+            },
+            "time": "2020-10-12T12:39:22+00:00"
+        },
+        {
+            "name": "psr/container",
+            "version": "1.1.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/container.git",
+                "reference": "513e0666f7216c7459170d56df27dfcefe1689ea"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/container/zipball/513e0666f7216c7459170d56df27dfcefe1689ea",
+                "reference": "513e0666f7216c7459170d56df27dfcefe1689ea",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.4.0"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Container\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common Container Interface (PHP FIG PSR-11)",
+            "homepage": "https://github.com/php-fig/container",
+            "keywords": [
+                "PSR-11",
+                "container",
+                "container-interface",
+                "container-interop",
+                "psr"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/container/issues",
+                "source": "https://github.com/php-fig/container/tree/1.1.2"
+            },
+            "time": "2021-11-05T16:50:12+00:00"
+        },
+        {
+            "name": "psr/http-factory",
+            "version": "1.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-factory.git",
+                "reference": "e616d01114759c4c489f93b099585439f795fe35"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-factory/zipball/e616d01114759c4c489f93b099585439f795fe35",
+                "reference": "e616d01114759c4c489f93b099585439f795fe35",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.0.0",
+                "psr/http-message": "^1.0 || ^2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interfaces for PSR-7 HTTP message factories",
+            "keywords": [
+                "factory",
+                "http",
+                "message",
+                "psr",
+                "psr-17",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-factory/tree/1.0.2"
+            },
+            "time": "2023-04-10T20:10:41+00:00"
+        },
+        {
+            "name": "psr/http-message",
+            "version": "1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-message.git",
+                "reference": "cb6ce4845ce34a8ad9e68117c10ee90a29919eba"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-message/zipball/cb6ce4845ce34a8ad9e68117c10ee90a29919eba",
+                "reference": "cb6ce4845ce34a8ad9e68117c10ee90a29919eba",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Message\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "http://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP messages",
+            "homepage": "https://github.com/php-fig/http-message",
+            "keywords": [
+                "http",
+                "http-message",
+                "psr",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-message/tree/1.1"
+            },
+            "time": "2023-04-04T09:50:52+00:00"
+        },
+        {
+            "name": "psr/http-server-handler",
+            "version": "1.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-server-handler.git",
+                "reference": "84c4fb66179be4caaf8e97bd239203245302e7d4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-server-handler/zipball/84c4fb66179be4caaf8e97bd239203245302e7d4",
+                "reference": "84c4fb66179be4caaf8e97bd239203245302e7d4",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.0",
+                "psr/http-message": "^1.0 || ^2.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Server\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP server-side request handler",
+            "keywords": [
+                "handler",
+                "http",
+                "http-interop",
+                "psr",
+                "psr-15",
+                "psr-7",
+                "request",
+                "response",
+                "server"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/http-server-handler/tree/1.0.2"
+            },
+            "time": "2023-04-10T20:06:20+00:00"
+        },
+        {
+            "name": "psr/http-server-middleware",
+            "version": "1.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/http-server-middleware.git",
+                "reference": "c1481f747daaa6a0782775cd6a8c26a1bf4a3829"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/http-server-middleware/zipball/c1481f747daaa6a0782775cd6a8c26a1bf4a3829",
+                "reference": "c1481f747daaa6a0782775cd6a8c26a1bf4a3829",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.0",
+                "psr/http-message": "^1.0 || ^2.0",
+                "psr/http-server-handler": "^1.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Http\\Server\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for HTTP server-side middleware",
+            "keywords": [
+                "http",
+                "http-interop",
+                "middleware",
+                "psr",
+                "psr-15",
+                "psr-7",
+                "request",
+                "response"
+            ],
+            "support": {
+                "issues": "https://github.com/php-fig/http-server-middleware/issues",
+                "source": "https://github.com/php-fig/http-server-middleware/tree/1.0.2"
+            },
+            "time": "2023-04-11T06:14:47+00:00"
+        },
+        {
+            "name": "psr/log",
+            "version": "3.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/php-fig/log.git",
+                "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/php-fig/log/zipball/fe5ea303b0887d5caefd3d431c3e61ad47037001",
+                "reference": "fe5ea303b0887d5caefd3d431c3e61ad47037001",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=8.0.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Psr\\Log\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "PHP-FIG",
+                    "homepage": "https://www.php-fig.org/"
+                }
+            ],
+            "description": "Common interface for logging libraries",
+            "homepage": "https://github.com/php-fig/log",
+            "keywords": [
+                "log",
+                "psr",
+                "psr-3"
+            ],
+            "support": {
+                "source": "https://github.com/php-fig/log/tree/3.0.0"
+            },
+            "time": "2021-07-14T16:46:02+00:00"
+        },
+        {
+            "name": "ralouphie/getallheaders",
+            "version": "3.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/ralouphie/getallheaders.git",
+                "reference": "120b605dfeb996808c31b6477290a714d356e822"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/ralouphie/getallheaders/zipball/120b605dfeb996808c31b6477290a714d356e822",
+                "reference": "120b605dfeb996808c31b6477290a714d356e822",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=5.6"
+            },
+            "require-dev": {
+                "php-coveralls/php-coveralls": "^2.1",
+                "phpunit/phpunit": "^5 || ^6.5"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/getallheaders.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ralph Khattar",
+                    "email": "ralph.khattar@gmail.com"
+                }
+            ],
+            "description": "A polyfill for getallheaders.",
+            "support": {
+                "issues": "https://github.com/ralouphie/getallheaders/issues",
+                "source": "https://github.com/ralouphie/getallheaders/tree/develop"
+            },
+            "time": "2019-03-08T08:55:37+00:00"
+        },
+        {
+            "name": "slim/psr7",
+            "version": "1.6.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/slimphp/Slim-Psr7.git",
+                "reference": "72d2b2bac94ab4575d369f605dbfafbe168d3163"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/slimphp/Slim-Psr7/zipball/72d2b2bac94ab4575d369f605dbfafbe168d3163",
+                "reference": "72d2b2bac94ab4575d369f605dbfafbe168d3163",
+                "shasum": ""
+            },
+            "require": {
+                "fig/http-message-util": "^1.1.5",
+                "php": "^7.4 || ^8.0",
+                "psr/http-factory": "^1.0",
+                "psr/http-message": "^1.0",
+                "ralouphie/getallheaders": "^3.0",
+                "symfony/polyfill-php80": "^1.26"
+            },
+            "provide": {
+                "psr/http-factory-implementation": "1.0",
+                "psr/http-message-implementation": "1.0"
+            },
+            "require-dev": {
+                "adriansuter/php-autoload-override": "^1.3",
+                "ext-json": "*",
+                "http-interop/http-factory-tests": "^0.9.0",
+                "php-http/psr7-integration-tests": "1.1",
+                "phpspec/prophecy": "^1.15",
+                "phpspec/prophecy-phpunit": "^2.0",
+                "phpstan/phpstan": "^1.8",
+                "phpunit/phpunit": "^9.5",
+                "squizlabs/php_codesniffer": "^3.7"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Slim\\Psr7\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Josh Lockhart",
+                    "email": "hello@joshlockhart.com",
+                    "homepage": "http://joshlockhart.com"
+                },
+                {
+                    "name": "Andrew Smith",
+                    "email": "a.smith@silentworks.co.uk",
+                    "homepage": "http://silentworks.co.uk"
+                },
+                {
+                    "name": "Rob Allen",
+                    "email": "rob@akrabat.com",
+                    "homepage": "http://akrabat.com"
+                },
+                {
+                    "name": "Pierre Berube",
+                    "email": "pierre@lgse.com",
+                    "homepage": "http://www.lgse.com"
+                }
+            ],
+            "description": "Strict PSR-7 implementation",
+            "homepage": "https://www.slimframework.com",
+            "keywords": [
+                "http",
+                "psr-7",
+                "psr7"
+            ],
+            "support": {
+                "issues": "https://github.com/slimphp/Slim-Psr7/issues",
+                "source": "https://github.com/slimphp/Slim-Psr7/tree/1.6.1"
+            },
+            "time": "2023-04-17T16:02:20+00:00"
+        },
+        {
+            "name": "slim/slim",
+            "version": "4.12.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/slimphp/Slim.git",
+                "reference": "e9e99c2b24398b967841c6c4c3048622cc7e2b18"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/slimphp/Slim/zipball/e9e99c2b24398b967841c6c4c3048622cc7e2b18",
+                "reference": "e9e99c2b24398b967841c6c4c3048622cc7e2b18",
+                "shasum": ""
+            },
+            "require": {
+                "ext-json": "*",
+                "nikic/fast-route": "^1.3",
+                "php": "^7.4 || ^8.0",
+                "psr/container": "^1.0 || ^2.0",
+                "psr/http-factory": "^1.0",
+                "psr/http-message": "^1.1",
+                "psr/http-server-handler": "^1.0",
+                "psr/http-server-middleware": "^1.0",
+                "psr/log": "^1.1 || ^2.0 || ^3.0"
+            },
+            "require-dev": {
+                "adriansuter/php-autoload-override": "^1.4",
+                "ext-simplexml": "*",
+                "guzzlehttp/psr7": "^2.5",
+                "httpsoft/http-message": "^1.1",
+                "httpsoft/http-server-request": "^1.1",
+                "laminas/laminas-diactoros": "^2.17",
+                "nyholm/psr7": "^1.8",
+                "nyholm/psr7-server": "^1.0",
+                "phpspec/prophecy": "^1.17",
+                "phpspec/prophecy-phpunit": "^2.0",
+                "phpstan/phpstan": "^1.10",
+                "phpunit/phpunit": "^9.6",
+                "slim/http": "^1.3",
+                "slim/psr7": "^1.6",
+                "squizlabs/php_codesniffer": "^3.7"
+            },
+            "suggest": {
+                "ext-simplexml": "Needed to support XML format in BodyParsingMiddleware",
+                "ext-xml": "Needed to support XML format in BodyParsingMiddleware",
+                "php-di/php-di": "PHP-DI is the recommended container library to be used with Slim",
+                "slim/psr7": "Slim PSR-7 implementation. See https://www.slimframework.com/docs/v4/start/installation.html for more information."
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Slim\\": "Slim"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Josh Lockhart",
+                    "email": "hello@joshlockhart.com",
+                    "homepage": "https://joshlockhart.com"
+                },
+                {
+                    "name": "Andrew Smith",
+                    "email": "a.smith@silentworks.co.uk",
+                    "homepage": "http://silentworks.co.uk"
+                },
+                {
+                    "name": "Rob Allen",
+                    "email": "rob@akrabat.com",
+                    "homepage": "http://akrabat.com"
+                },
+                {
+                    "name": "Pierre Berube",
+                    "email": "pierre@lgse.com",
+                    "homepage": "http://www.lgse.com"
+                },
+                {
+                    "name": "Gabriel Manricks",
+                    "email": "gmanricks@me.com",
+                    "homepage": "http://gabrielmanricks.com"
+                }
+            ],
+            "description": "Slim is a PHP micro framework that helps you quickly write simple yet powerful web applications and APIs",
+            "homepage": "https://www.slimframework.com",
+            "keywords": [
+                "api",
+                "framework",
+                "micro",
+                "router"
+            ],
+            "support": {
+                "docs": "https://www.slimframework.com/docs/v4/",
+                "forum": "https://discourse.slimframework.com/",
+                "irc": "irc://irc.freenode.net:6667/slimphp",
+                "issues": "https://github.com/slimphp/Slim/issues",
+                "rss": "https://www.slimframework.com/blog/feed.rss",
+                "slack": "https://slimphp.slack.com/",
+                "source": "https://github.com/slimphp/Slim",
+                "wiki": "https://github.com/slimphp/Slim/wiki"
+            },
+            "funding": [
+                {
+                    "url": "https://opencollective.com/slimphp",
+                    "type": "open_collective"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/slim/slim",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-07-23T04:54:29+00:00"
+        },
+        {
+            "name": "symfony/polyfill-php80",
+            "version": "v1.28.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/symfony/polyfill-php80.git",
+                "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/symfony/polyfill-php80/zipball/6caa57379c4aec19c0a12a38b59b26487dcfe4b5",
+                "reference": "6caa57379c4aec19c0a12a38b59b26487dcfe4b5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.1"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-main": "1.28-dev"
+                },
+                "thanks": {
+                    "name": "symfony/polyfill",
+                    "url": "https://github.com/symfony/polyfill"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ],
+                "psr-4": {
+                    "Symfony\\Polyfill\\Php80\\": ""
+                },
+                "classmap": [
+                    "Resources/stubs"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Ion Bazan",
+                    "email": "ion.bazan@gmail.com"
+                },
+                {
+                    "name": "Nicolas Grekas",
+                    "email": "p@tchwork.com"
+                },
+                {
+                    "name": "Symfony Community",
+                    "homepage": "https://symfony.com/contributors"
+                }
+            ],
+            "description": "Symfony polyfill backporting some PHP 8.0+ features to lower PHP versions",
+            "homepage": "https://symfony.com",
+            "keywords": [
+                "compatibility",
+                "polyfill",
+                "portable",
+                "shim"
+            ],
+            "support": {
+                "source": "https://github.com/symfony/polyfill-php80/tree/v1.28.0"
+            },
+            "funding": [
+                {
+                    "url": "https://symfony.com/sponsor",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/fabpot",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/symfony/symfony",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-01-26T09:26:14+00:00"
+        }
+    ],
+    "packages-dev": [
+        {
+            "name": "doctrine/deprecations",
+            "version": "1.1.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/deprecations.git",
+                "reference": "4f2d4f2836e7ec4e7a8625e75c6aa916004db931"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/deprecations/zipball/4f2d4f2836e7ec4e7a8625e75c6aa916004db931",
+                "reference": "4f2d4f2836e7ec4e7a8625e75c6aa916004db931",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^9",
+                "phpstan/phpstan": "1.4.10 || 1.10.15",
+                "phpstan/phpstan-phpunit": "^1.0",
+                "phpunit/phpunit": "^7.5 || ^8.5 || ^9.5",
+                "psalm/plugin-phpunit": "0.18.4",
+                "psr/log": "^1 || ^2 || ^3",
+                "vimeo/psalm": "4.30.0 || 5.12.0"
+            },
+            "suggest": {
+                "psr/log": "Allows logging deprecations via PSR-3 logger implementation"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Deprecations\\": "lib/Doctrine/Deprecations"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "A small layer on top of trigger_error(E_USER_DEPRECATED) or PSR-3 logging with options to disable all deprecations or selectively for packages.",
+            "homepage": "https://www.doctrine-project.org/",
+            "support": {
+                "issues": "https://github.com/doctrine/deprecations/issues",
+                "source": "https://github.com/doctrine/deprecations/tree/1.1.2"
+            },
+            "time": "2023-09-27T20:04:15+00:00"
+        },
+        {
+            "name": "doctrine/instantiator",
+            "version": "2.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/doctrine/instantiator.git",
+                "reference": "c6222283fa3f4ac679f8b9ced9a4e23f163e80d0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/doctrine/instantiator/zipball/c6222283fa3f4ac679f8b9ced9a4e23f163e80d0",
+                "reference": "c6222283fa3f4ac679f8b9ced9a4e23f163e80d0",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^8.1"
+            },
+            "require-dev": {
+                "doctrine/coding-standard": "^11",
+                "ext-pdo": "*",
+                "ext-phar": "*",
+                "phpbench/phpbench": "^1.2",
+                "phpstan/phpstan": "^1.9.4",
+                "phpstan/phpstan-phpunit": "^1.3",
+                "phpunit/phpunit": "^9.5.27",
+                "vimeo/psalm": "^5.4"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "Doctrine\\Instantiator\\": "src/Doctrine/Instantiator/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Marco Pivetta",
+                    "email": "ocramius@gmail.com",
+                    "homepage": "https://ocramius.github.io/"
+                }
+            ],
+            "description": "A small, lightweight utility to instantiate objects in PHP without invoking their constructors",
+            "homepage": "https://www.doctrine-project.org/projects/instantiator.html",
+            "keywords": [
+                "constructor",
+                "instantiate"
+            ],
+            "support": {
+                "issues": "https://github.com/doctrine/instantiator/issues",
+                "source": "https://github.com/doctrine/instantiator/tree/2.0.0"
+            },
+            "funding": [
+                {
+                    "url": "https://www.doctrine-project.org/sponsorship.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://www.patreon.com/phpdoctrine",
+                    "type": "patreon"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/doctrine%2Finstantiator",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2022-12-30T00:23:10+00:00"
+        },
+        {
+            "name": "jangregor/phpstan-prophecy",
+            "version": "1.0.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/Jan0707/phpstan-prophecy.git",
+                "reference": "2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/Jan0707/phpstan-prophecy/zipball/2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0",
+                "reference": "2bc7ca9460395690c6bf7332bdfb2f25d5cae8e0",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0",
+                "phpstan/phpstan": "^1.0.0"
+            },
+            "conflict": {
+                "phpspec/prophecy": "<1.7.0,>=2.0.0",
+                "phpunit/phpunit": "<6.0.0,>=10.0.0"
+            },
+            "require-dev": {
+                "ergebnis/composer-normalize": "^2.1.1",
+                "ergebnis/license": "^1.0.0",
+                "ergebnis/php-cs-fixer-config": "~2.2.0",
+                "phpspec/prophecy": "^1.7.0",
+                "phpunit/phpunit": "^6.0.0 || ^7.0.0 || ^8.0.0 || ^9.0.0"
+            },
+            "type": "phpstan-extension",
+            "extra": {
+                "phpstan": {
+                    "includes": [
+                        "extension.neon"
+                    ]
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "JanGregor\\Prophecy\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jan Gregor Emge-Triebel",
+                    "email": "jan@jangregor.me"
+                }
+            ],
+            "description": "Provides a phpstan/phpstan extension for phpspec/prophecy",
+            "support": {
+                "issues": "https://github.com/Jan0707/phpstan-prophecy/issues",
+                "source": "https://github.com/Jan0707/phpstan-prophecy/tree/1.0.0"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/localheinz",
+                    "type": "github"
+                }
+            ],
+            "time": "2021-11-08T16:37:47+00:00"
+        },
+        {
+            "name": "myclabs/deep-copy",
+            "version": "1.11.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/myclabs/DeepCopy.git",
+                "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/myclabs/DeepCopy/zipball/7284c22080590fb39f2ffa3e9057f10a4ddd0e0c",
+                "reference": "7284c22080590fb39f2ffa3e9057f10a4ddd0e0c",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.1 || ^8.0"
+            },
+            "conflict": {
+                "doctrine/collections": "<1.6.8",
+                "doctrine/common": "<2.13.3 || >=3,<3.2.2"
+            },
+            "require-dev": {
+                "doctrine/collections": "^1.6.8",
+                "doctrine/common": "^2.13.3 || ^3.2.2",
+                "phpunit/phpunit": "^7.5.20 || ^8.5.23 || ^9.5.13"
+            },
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "src/DeepCopy/deep_copy.php"
+                ],
+                "psr-4": {
+                    "DeepCopy\\": "src/DeepCopy/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Create deep copies (clones) of your objects",
+            "keywords": [
+                "clone",
+                "copy",
+                "duplicate",
+                "object",
+                "object graph"
+            ],
+            "support": {
+                "issues": "https://github.com/myclabs/DeepCopy/issues",
+                "source": "https://github.com/myclabs/DeepCopy/tree/1.11.1"
+            },
+            "funding": [
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/myclabs/deep-copy",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-03-08T13:26:56+00:00"
+        },
+        {
+            "name": "nikic/php-parser",
+            "version": "v4.17.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/nikic/PHP-Parser.git",
+                "reference": "a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/nikic/PHP-Parser/zipball/a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d",
+                "reference": "a6303e50c90c355c7eeee2c4a8b27fe8dc8fef1d",
+                "shasum": ""
+            },
+            "require": {
+                "ext-tokenizer": "*",
+                "php": ">=7.0"
+            },
+            "require-dev": {
+                "ircmaxell/php-yacc": "^0.0.7",
+                "phpunit/phpunit": "^6.5 || ^7.0 || ^8.0 || ^9.0"
+            },
+            "bin": [
+                "bin/php-parse"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.9-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "PhpParser\\": "lib/PhpParser"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Nikita Popov"
+                }
+            ],
+            "description": "A PHP parser written in PHP",
+            "keywords": [
+                "parser",
+                "php"
+            ],
+            "support": {
+                "issues": "https://github.com/nikic/PHP-Parser/issues",
+                "source": "https://github.com/nikic/PHP-Parser/tree/v4.17.1"
+            },
+            "time": "2023-08-13T19:53:39+00:00"
+        },
+        {
+            "name": "phar-io/manifest",
+            "version": "2.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phar-io/manifest.git",
+                "reference": "97803eca37d319dfa7826cc2437fc020857acb53"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phar-io/manifest/zipball/97803eca37d319dfa7826cc2437fc020857acb53",
+                "reference": "97803eca37d319dfa7826cc2437fc020857acb53",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-phar": "*",
+                "ext-xmlwriter": "*",
+                "phar-io/version": "^3.0.1",
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0.x-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Heuer",
+                    "email": "sebastian@phpeople.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "Component for reading phar.io manifest information from a PHP Archive (PHAR)",
+            "support": {
+                "issues": "https://github.com/phar-io/manifest/issues",
+                "source": "https://github.com/phar-io/manifest/tree/2.0.3"
+            },
+            "time": "2021-07-20T11:28:43+00:00"
+        },
+        {
+            "name": "phar-io/version",
+            "version": "3.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phar-io/version.git",
+                "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phar-io/version/zipball/4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+                "reference": "4f7fd7836c6f332bb2933569e566a0d6c4cbed74",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Heuer",
+                    "email": "sebastian@phpeople.de",
+                    "role": "Developer"
+                },
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "Library for handling version information and constraints",
+            "support": {
+                "issues": "https://github.com/phar-io/version/issues",
+                "source": "https://github.com/phar-io/version/tree/3.2.1"
+            },
+            "time": "2022-02-21T01:04:05+00:00"
+        },
+        {
+            "name": "phpdocumentor/reflection-common",
+            "version": "2.2.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionCommon.git",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionCommon/zipball/1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "reference": "1d01c49d4ed62f25aa84a747ad35d5a16924662b",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-2.x": "2.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Jaap van Otterdijk",
+                    "email": "opensource@ijaap.nl"
+                }
+            ],
+            "description": "Common reflection classes used by phpdocumentor to reflect the code structure",
+            "homepage": "http://www.phpdoc.org",
+            "keywords": [
+                "FQSEN",
+                "phpDocumentor",
+                "phpdoc",
+                "reflection",
+                "static analysis"
+            ],
+            "support": {
+                "issues": "https://github.com/phpDocumentor/ReflectionCommon/issues",
+                "source": "https://github.com/phpDocumentor/ReflectionCommon/tree/2.x"
+            },
+            "time": "2020-06-27T09:03:43+00:00"
+        },
+        {
+            "name": "phpdocumentor/reflection-docblock",
+            "version": "5.3.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/ReflectionDocBlock.git",
+                "reference": "622548b623e81ca6d78b721c5e029f4ce664f170"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/ReflectionDocBlock/zipball/622548b623e81ca6d78b721c5e029f4ce664f170",
+                "reference": "622548b623e81ca6d78b721c5e029f4ce664f170",
+                "shasum": ""
+            },
+            "require": {
+                "ext-filter": "*",
+                "php": "^7.2 || ^8.0",
+                "phpdocumentor/reflection-common": "^2.2",
+                "phpdocumentor/type-resolver": "^1.3",
+                "webmozart/assert": "^1.9.1"
+            },
+            "require-dev": {
+                "mockery/mockery": "~1.3.2",
+                "psalm/phar": "^4.8"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                },
+                {
+                    "name": "Jaap van Otterdijk",
+                    "email": "account@ijaap.nl"
+                }
+            ],
+            "description": "With this component, a library can provide support for annotations via DocBlocks or otherwise retrieve information that is embedded in a DocBlock.",
+            "support": {
+                "issues": "https://github.com/phpDocumentor/ReflectionDocBlock/issues",
+                "source": "https://github.com/phpDocumentor/ReflectionDocBlock/tree/5.3.0"
+            },
+            "time": "2021-10-19T17:43:47+00:00"
+        },
+        {
+            "name": "phpdocumentor/type-resolver",
+            "version": "1.7.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpDocumentor/TypeResolver.git",
+                "reference": "3219c6ee25c9ea71e3d9bbaf39c67c9ebd499419"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpDocumentor/TypeResolver/zipball/3219c6ee25c9ea71e3d9bbaf39c67c9ebd499419",
+                "reference": "3219c6ee25c9ea71e3d9bbaf39c67c9ebd499419",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/deprecations": "^1.0",
+                "php": "^7.4 || ^8.0",
+                "phpdocumentor/reflection-common": "^2.0",
+                "phpstan/phpdoc-parser": "^1.13"
+            },
+            "require-dev": {
+                "ext-tokenizer": "*",
+                "phpbench/phpbench": "^1.2",
+                "phpstan/extension-installer": "^1.1",
+                "phpstan/phpstan": "^1.8",
+                "phpstan/phpstan-phpunit": "^1.1",
+                "phpunit/phpunit": "^9.5",
+                "rector/rector": "^0.13.9",
+                "vimeo/psalm": "^4.25"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-1.x": "1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "phpDocumentor\\Reflection\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Mike van Riel",
+                    "email": "me@mikevanriel.com"
+                }
+            ],
+            "description": "A PSR-5 based resolver of Class names, Types and Structural Element Names",
+            "support": {
+                "issues": "https://github.com/phpDocumentor/TypeResolver/issues",
+                "source": "https://github.com/phpDocumentor/TypeResolver/tree/1.7.3"
+            },
+            "time": "2023-08-12T11:01:26+00:00"
+        },
+        {
+            "name": "phpspec/prophecy",
+            "version": "v1.17.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpspec/prophecy.git",
+                "reference": "15873c65b207b07765dbc3c95d20fdf4a320cbe2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpspec/prophecy/zipball/15873c65b207b07765dbc3c95d20fdf4a320cbe2",
+                "reference": "15873c65b207b07765dbc3c95d20fdf4a320cbe2",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/instantiator": "^1.2 || ^2.0",
+                "php": "^7.2 || 8.0.* || 8.1.* || 8.2.*",
+                "phpdocumentor/reflection-docblock": "^5.2",
+                "sebastian/comparator": "^3.0 || ^4.0",
+                "sebastian/recursion-context": "^3.0 || ^4.0"
+            },
+            "require-dev": {
+                "phpspec/phpspec": "^6.0 || ^7.0",
+                "phpstan/phpstan": "^1.9",
+                "phpunit/phpunit": "^8.0 || ^9.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.x-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Prophecy\\": "src/Prophecy"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Konstantin Kudryashov",
+                    "email": "ever.zet@gmail.com",
+                    "homepage": "http://everzet.com"
+                },
+                {
+                    "name": "Marcello Duarte",
+                    "email": "marcello.duarte@gmail.com"
+                }
+            ],
+            "description": "Highly opinionated mocking framework for PHP 5.3+",
+            "homepage": "https://github.com/phpspec/prophecy",
+            "keywords": [
+                "Double",
+                "Dummy",
+                "fake",
+                "mock",
+                "spy",
+                "stub"
+            ],
+            "support": {
+                "issues": "https://github.com/phpspec/prophecy/issues",
+                "source": "https://github.com/phpspec/prophecy/tree/v1.17.0"
+            },
+            "time": "2023-02-02T15:41:36+00:00"
+        },
+        {
+            "name": "phpspec/prophecy-phpunit",
+            "version": "v2.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpspec/prophecy-phpunit.git",
+                "reference": "9f26c224a2fa335f33e6666cc078fbf388255e87"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpspec/prophecy-phpunit/zipball/9f26c224a2fa335f33e6666cc078fbf388255e87",
+                "reference": "9f26c224a2fa335f33e6666cc078fbf388255e87",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.3 || ^8",
+                "phpspec/prophecy": "^1.3",
+                "phpunit/phpunit": "^9.1"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Prophecy\\PhpUnit\\": "src"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Christophe Coevoet",
+                    "email": "stof@notk.org"
+                }
+            ],
+            "description": "Integrating the Prophecy mocking library in PHPUnit test cases",
+            "homepage": "http://phpspec.net",
+            "keywords": [
+                "phpunit",
+                "prophecy"
+            ],
+            "support": {
+                "issues": "https://github.com/phpspec/prophecy-phpunit/issues",
+                "source": "https://github.com/phpspec/prophecy-phpunit/tree/v2.0.2"
+            },
+            "time": "2023-04-18T11:58:05+00:00"
+        },
+        {
+            "name": "phpstan/extension-installer",
+            "version": "1.3.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpstan/extension-installer.git",
+                "reference": "f45734bfb9984c6c56c4486b71230355f066a58a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpstan/extension-installer/zipball/f45734bfb9984c6c56c4486b71230355f066a58a",
+                "reference": "f45734bfb9984c6c56c4486b71230355f066a58a",
+                "shasum": ""
+            },
+            "require": {
+                "composer-plugin-api": "^2.0",
+                "php": "^7.2 || ^8.0",
+                "phpstan/phpstan": "^1.9.0"
+            },
+            "require-dev": {
+                "composer/composer": "^2.0",
+                "php-parallel-lint/php-parallel-lint": "^1.2.0",
+                "phpstan/phpstan-strict-rules": "^0.11 || ^0.12 || ^1.0"
+            },
+            "type": "composer-plugin",
+            "extra": {
+                "class": "PHPStan\\ExtensionInstaller\\Plugin"
+            },
+            "autoload": {
+                "psr-4": {
+                    "PHPStan\\ExtensionInstaller\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "Composer plugin for automatic installation of PHPStan extensions",
+            "support": {
+                "issues": "https://github.com/phpstan/extension-installer/issues",
+                "source": "https://github.com/phpstan/extension-installer/tree/1.3.1"
+            },
+            "time": "2023-05-24T08:59:17+00:00"
+        },
+        {
+            "name": "phpstan/phpdoc-parser",
+            "version": "1.24.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpstan/phpdoc-parser.git",
+                "reference": "bcad8d995980440892759db0c32acae7c8e79442"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpstan/phpdoc-parser/zipball/bcad8d995980440892759db0c32acae7c8e79442",
+                "reference": "bcad8d995980440892759db0c32acae7c8e79442",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2 || ^8.0"
+            },
+            "require-dev": {
+                "doctrine/annotations": "^2.0",
+                "nikic/php-parser": "^4.15",
+                "php-parallel-lint/php-parallel-lint": "^1.2",
+                "phpstan/extension-installer": "^1.0",
+                "phpstan/phpstan": "^1.5",
+                "phpstan/phpstan-phpunit": "^1.1",
+                "phpstan/phpstan-strict-rules": "^1.0",
+                "phpunit/phpunit": "^9.5",
+                "symfony/process": "^5.2"
+            },
+            "type": "library",
+            "autoload": {
+                "psr-4": {
+                    "PHPStan\\PhpDocParser\\": [
+                        "src/"
+                    ]
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "PHPDoc parser with support for nullable, intersection and generic types",
+            "support": {
+                "issues": "https://github.com/phpstan/phpdoc-parser/issues",
+                "source": "https://github.com/phpstan/phpdoc-parser/tree/1.24.2"
+            },
+            "time": "2023-09-26T12:28:12+00:00"
+        },
+        {
+            "name": "phpstan/phpstan",
+            "version": "1.10.39",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/phpstan/phpstan.git",
+                "reference": "d9dedb0413f678b4d03cbc2279a48f91592c97c4"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/phpstan/phpstan/zipball/d9dedb0413f678b4d03cbc2279a48f91592c97c4",
+                "reference": "d9dedb0413f678b4d03cbc2279a48f91592c97c4",
+                "shasum": ""
+            },
+            "require": {
+                "php": "^7.2|^8.0"
+            },
+            "conflict": {
+                "phpstan/phpstan-shim": "*"
+            },
+            "bin": [
+                "phpstan",
+                "phpstan.phar"
+            ],
+            "type": "library",
+            "autoload": {
+                "files": [
+                    "bootstrap.php"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "description": "PHPStan - PHP Static Analysis Tool",
+            "keywords": [
+                "dev",
+                "static analysis"
+            ],
+            "support": {
+                "docs": "https://phpstan.org/user-guide/getting-started",
+                "forum": "https://github.com/phpstan/phpstan/discussions",
+                "issues": "https://github.com/phpstan/phpstan/issues",
+                "security": "https://github.com/phpstan/phpstan/security/policy",
+                "source": "https://github.com/phpstan/phpstan-src"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/ondrejmirtes",
+                    "type": "github"
+                },
+                {
+                    "url": "https://github.com/phpstan",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpstan/phpstan",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-10-17T15:46:26+00:00"
+        },
+        {
+            "name": "phpunit/php-code-coverage",
+            "version": "9.2.29",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-code-coverage.git",
+                "reference": "6a3a87ac2bbe33b25042753df8195ba4aa534c76"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-code-coverage/zipball/6a3a87ac2bbe33b25042753df8195ba4aa534c76",
+                "reference": "6a3a87ac2bbe33b25042753df8195ba4aa534c76",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-libxml": "*",
+                "ext-xmlwriter": "*",
+                "nikic/php-parser": "^4.15",
+                "php": ">=7.3",
+                "phpunit/php-file-iterator": "^3.0.3",
+                "phpunit/php-text-template": "^2.0.2",
+                "sebastian/code-unit-reverse-lookup": "^2.0.2",
+                "sebastian/complexity": "^2.0",
+                "sebastian/environment": "^5.1.2",
+                "sebastian/lines-of-code": "^1.0.3",
+                "sebastian/version": "^3.0.1",
+                "theseer/tokenizer": "^1.2.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "suggest": {
+                "ext-pcov": "PHP extension that provides line coverage",
+                "ext-xdebug": "PHP extension that provides line coverage as well as branch and path coverage"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "9.2-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that provides collection, processing, and rendering functionality for PHP code coverage information.",
+            "homepage": "https://github.com/sebastianbergmann/php-code-coverage",
+            "keywords": [
+                "coverage",
+                "testing",
+                "xunit"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-code-coverage/issues",
+                "security": "https://github.com/sebastianbergmann/php-code-coverage/security/policy",
+                "source": "https://github.com/sebastianbergmann/php-code-coverage/tree/9.2.29"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-09-19T04:57:46+00:00"
+        },
+        {
+            "name": "phpunit/php-file-iterator",
+            "version": "3.0.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-file-iterator.git",
+                "reference": "cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-file-iterator/zipball/cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf",
+                "reference": "cf1c2e7c203ac650e352f4cc675a7021e7d1b3cf",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "FilterIterator implementation that filters files based on a list of suffixes.",
+            "homepage": "https://github.com/sebastianbergmann/php-file-iterator/",
+            "keywords": [
+                "filesystem",
+                "iterator"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-file-iterator/issues",
+                "source": "https://github.com/sebastianbergmann/php-file-iterator/tree/3.0.6"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2021-12-02T12:48:52+00:00"
+        },
+        {
+            "name": "phpunit/php-invoker",
+            "version": "3.1.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-invoker.git",
+                "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-invoker/zipball/5a10147d0aaf65b58940a0b72f71c9ac0423cc67",
+                "reference": "5a10147d0aaf65b58940a0b72f71c9ac0423cc67",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "ext-pcntl": "*",
+                "phpunit/phpunit": "^9.3"
+            },
+            "suggest": {
+                "ext-pcntl": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.1-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Invoke callables with a timeout",
+            "homepage": "https://github.com/sebastianbergmann/php-invoker/",
+            "keywords": [
+                "process"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-invoker/issues",
+                "source": "https://github.com/sebastianbergmann/php-invoker/tree/3.1.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-09-28T05:58:55+00:00"
+        },
+        {
+            "name": "phpunit/php-text-template",
+            "version": "2.0.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-text-template.git",
+                "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-text-template/zipball/5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28",
+                "reference": "5da5f67fc95621df9ff4c4e5a84d6a8a2acf7c28",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Simple template engine.",
+            "homepage": "https://github.com/sebastianbergmann/php-text-template/",
+            "keywords": [
+                "template"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-text-template/issues",
+                "source": "https://github.com/sebastianbergmann/php-text-template/tree/2.0.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T05:33:50+00:00"
+        },
+        {
+            "name": "phpunit/php-timer",
+            "version": "5.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/php-timer.git",
+                "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/php-timer/zipball/5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2",
+                "reference": "5a63ce20ed1b5bf577850e2c4e87f4aa902afbd2",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Utility class for timing",
+            "homepage": "https://github.com/sebastianbergmann/php-timer/",
+            "keywords": [
+                "timer"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/php-timer/issues",
+                "source": "https://github.com/sebastianbergmann/php-timer/tree/5.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T13:16:10+00:00"
+        },
+        {
+            "name": "phpunit/phpunit",
+            "version": "9.6.13",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/phpunit.git",
+                "reference": "f3d767f7f9e191eab4189abe41ab37797e30b1be"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/phpunit/zipball/f3d767f7f9e191eab4189abe41ab37797e30b1be",
+                "reference": "f3d767f7f9e191eab4189abe41ab37797e30b1be",
+                "shasum": ""
+            },
+            "require": {
+                "doctrine/instantiator": "^1.3.1 || ^2",
+                "ext-dom": "*",
+                "ext-json": "*",
+                "ext-libxml": "*",
+                "ext-mbstring": "*",
+                "ext-xml": "*",
+                "ext-xmlwriter": "*",
+                "myclabs/deep-copy": "^1.10.1",
+                "phar-io/manifest": "^2.0.3",
+                "phar-io/version": "^3.0.2",
+                "php": ">=7.3",
+                "phpunit/php-code-coverage": "^9.2.28",
+                "phpunit/php-file-iterator": "^3.0.5",
+                "phpunit/php-invoker": "^3.1.1",
+                "phpunit/php-text-template": "^2.0.3",
+                "phpunit/php-timer": "^5.0.2",
+                "sebastian/cli-parser": "^1.0.1",
+                "sebastian/code-unit": "^1.0.6",
+                "sebastian/comparator": "^4.0.8",
+                "sebastian/diff": "^4.0.3",
+                "sebastian/environment": "^5.1.3",
+                "sebastian/exporter": "^4.0.5",
+                "sebastian/global-state": "^5.0.1",
+                "sebastian/object-enumerator": "^4.0.3",
+                "sebastian/resource-operations": "^3.0.3",
+                "sebastian/type": "^3.2",
+                "sebastian/version": "^3.0.2"
+            },
+            "suggest": {
+                "ext-soap": "To be able to generate mocks based on WSDL files",
+                "ext-xdebug": "PHP extension that provides line coverage as well as branch and path coverage"
+            },
+            "bin": [
+                "phpunit"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "9.6-dev"
+                }
+            },
+            "autoload": {
+                "files": [
+                    "src/Framework/Assert/Functions.php"
+                ],
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "The PHP Unit Testing framework.",
+            "homepage": "https://phpunit.de/",
+            "keywords": [
+                "phpunit",
+                "testing",
+                "xunit"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/phpunit/issues",
+                "security": "https://github.com/sebastianbergmann/phpunit/security/policy",
+                "source": "https://github.com/sebastianbergmann/phpunit/tree/9.6.13"
+            },
+            "funding": [
+                {
+                    "url": "https://phpunit.de/sponsors.html",
+                    "type": "custom"
+                },
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                },
+                {
+                    "url": "https://tidelift.com/funding/github/packagist/phpunit/phpunit",
+                    "type": "tidelift"
+                }
+            ],
+            "time": "2023-09-19T05:39:22+00:00"
+        },
+        {
+            "name": "sebastian/cli-parser",
+            "version": "1.0.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/cli-parser.git",
+                "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/cli-parser/zipball/442e7c7e687e42adc03470c7b668bc4b2402c0b2",
+                "reference": "442e7c7e687e42adc03470c7b668bc4b2402c0b2",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for parsing CLI options",
+            "homepage": "https://github.com/sebastianbergmann/cli-parser",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/cli-parser/issues",
+                "source": "https://github.com/sebastianbergmann/cli-parser/tree/1.0.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-09-28T06:08:49+00:00"
+        },
+        {
+            "name": "sebastian/code-unit",
+            "version": "1.0.8",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/code-unit.git",
+                "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/code-unit/zipball/1fc9f64c0927627ef78ba436c9b17d967e68e120",
+                "reference": "1fc9f64c0927627ef78ba436c9b17d967e68e120",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Collection of value objects that represent the PHP code units",
+            "homepage": "https://github.com/sebastianbergmann/code-unit",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/code-unit/issues",
+                "source": "https://github.com/sebastianbergmann/code-unit/tree/1.0.8"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T13:08:54+00:00"
+        },
+        {
+            "name": "sebastian/code-unit-reverse-lookup",
+            "version": "2.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/code-unit-reverse-lookup.git",
+                "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/code-unit-reverse-lookup/zipball/ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5",
+                "reference": "ac91f01ccec49fb77bdc6fd1e548bc70f7faa3e5",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Looks up which function or method a line of code belongs to",
+            "homepage": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/issues",
+                "source": "https://github.com/sebastianbergmann/code-unit-reverse-lookup/tree/2.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-09-28T05:30:19+00:00"
+        },
+        {
+            "name": "sebastian/comparator",
+            "version": "4.0.8",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/comparator.git",
+                "reference": "fa0f136dd2334583309d32b62544682ee972b51a"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/comparator/zipball/fa0f136dd2334583309d32b62544682ee972b51a",
+                "reference": "fa0f136dd2334583309d32b62544682ee972b51a",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3",
+                "sebastian/diff": "^4.0",
+                "sebastian/exporter": "^4.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@2bepublished.at"
+                }
+            ],
+            "description": "Provides the functionality to compare PHP values for equality",
+            "homepage": "https://github.com/sebastianbergmann/comparator",
+            "keywords": [
+                "comparator",
+                "compare",
+                "equality"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/comparator/issues",
+                "source": "https://github.com/sebastianbergmann/comparator/tree/4.0.8"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2022-09-14T12:41:17+00:00"
+        },
+        {
+            "name": "sebastian/complexity",
+            "version": "2.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/complexity.git",
+                "reference": "739b35e53379900cc9ac327b2147867b8b6efd88"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/complexity/zipball/739b35e53379900cc9ac327b2147867b8b6efd88",
+                "reference": "739b35e53379900cc9ac327b2147867b8b6efd88",
+                "shasum": ""
+            },
+            "require": {
+                "nikic/php-parser": "^4.7",
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for calculating the complexity of PHP code units",
+            "homepage": "https://github.com/sebastianbergmann/complexity",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/complexity/issues",
+                "source": "https://github.com/sebastianbergmann/complexity/tree/2.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T15:52:27+00:00"
+        },
+        {
+            "name": "sebastian/diff",
+            "version": "4.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/diff.git",
+                "reference": "74be17022044ebaaecfdf0c5cd504fc9cd5a7131"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/diff/zipball/74be17022044ebaaecfdf0c5cd504fc9cd5a7131",
+                "reference": "74be17022044ebaaecfdf0c5cd504fc9cd5a7131",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3",
+                "symfony/process": "^4.2 || ^5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Kore Nordmann",
+                    "email": "mail@kore-nordmann.de"
+                }
+            ],
+            "description": "Diff implementation",
+            "homepage": "https://github.com/sebastianbergmann/diff",
+            "keywords": [
+                "diff",
+                "udiff",
+                "unidiff",
+                "unified diff"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/diff/issues",
+                "source": "https://github.com/sebastianbergmann/diff/tree/4.0.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-05-07T05:35:17+00:00"
+        },
+        {
+            "name": "sebastian/environment",
+            "version": "5.1.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/environment.git",
+                "reference": "830c43a844f1f8d5b7a1f6d6076b784454d8b7ed"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/environment/zipball/830c43a844f1f8d5b7a1f6d6076b784454d8b7ed",
+                "reference": "830c43a844f1f8d5b7a1f6d6076b784454d8b7ed",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "suggest": {
+                "ext-posix": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.1-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Provides functionality to handle HHVM/PHP environments",
+            "homepage": "http://www.github.com/sebastianbergmann/environment",
+            "keywords": [
+                "Xdebug",
+                "environment",
+                "hhvm"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/environment/issues",
+                "source": "https://github.com/sebastianbergmann/environment/tree/5.1.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-02-03T06:03:51+00:00"
+        },
+        {
+            "name": "sebastian/exporter",
+            "version": "4.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/exporter.git",
+                "reference": "ac230ed27f0f98f597c8a2b6eb7ac563af5e5b9d"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/exporter/zipball/ac230ed27f0f98f597c8a2b6eb7ac563af5e5b9d",
+                "reference": "ac230ed27f0f98f597c8a2b6eb7ac563af5e5b9d",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3",
+                "sebastian/recursion-context": "^4.0"
+            },
+            "require-dev": {
+                "ext-mbstring": "*",
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Volker Dusch",
+                    "email": "github@wallbash.com"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                },
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@gmail.com"
+                }
+            ],
+            "description": "Provides the functionality to export PHP variables for visualization",
+            "homepage": "https://www.github.com/sebastianbergmann/exporter",
+            "keywords": [
+                "export",
+                "exporter"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/exporter/issues",
+                "source": "https://github.com/sebastianbergmann/exporter/tree/4.0.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2022-09-14T06:03:37+00:00"
+        },
+        {
+            "name": "sebastian/global-state",
+            "version": "5.0.6",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/global-state.git",
+                "reference": "bde739e7565280bda77be70044ac1047bc007e34"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/global-state/zipball/bde739e7565280bda77be70044ac1047bc007e34",
+                "reference": "bde739e7565280bda77be70044ac1047bc007e34",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3",
+                "sebastian/object-reflector": "^2.0",
+                "sebastian/recursion-context": "^4.0"
+            },
+            "require-dev": {
+                "ext-dom": "*",
+                "phpunit/phpunit": "^9.3"
+            },
+            "suggest": {
+                "ext-uopz": "*"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "5.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Snapshotting of global state",
+            "homepage": "http://www.github.com/sebastianbergmann/global-state",
+            "keywords": [
+                "global state"
+            ],
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/global-state/issues",
+                "source": "https://github.com/sebastianbergmann/global-state/tree/5.0.6"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-08-02T09:26:13+00:00"
+        },
+        {
+            "name": "sebastian/lines-of-code",
+            "version": "1.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/lines-of-code.git",
+                "reference": "c1c2e997aa3146983ed888ad08b15470a2e22ecc"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/lines-of-code/zipball/c1c2e997aa3146983ed888ad08b15470a2e22ecc",
+                "reference": "c1c2e997aa3146983ed888ad08b15470a2e22ecc",
+                "shasum": ""
+            },
+            "require": {
+                "nikic/php-parser": "^4.6",
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library for counting the lines of code in PHP source code",
+            "homepage": "https://github.com/sebastianbergmann/lines-of-code",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/lines-of-code/issues",
+                "source": "https://github.com/sebastianbergmann/lines-of-code/tree/1.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-11-28T06:42:11+00:00"
+        },
+        {
+            "name": "sebastian/object-enumerator",
+            "version": "4.0.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/object-enumerator.git",
+                "reference": "5c9eeac41b290a3712d88851518825ad78f45c71"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/object-enumerator/zipball/5c9eeac41b290a3712d88851518825ad78f45c71",
+                "reference": "5c9eeac41b290a3712d88851518825ad78f45c71",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3",
+                "sebastian/object-reflector": "^2.0",
+                "sebastian/recursion-context": "^4.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Traverses array structures and object graphs to enumerate all referenced objects",
+            "homepage": "https://github.com/sebastianbergmann/object-enumerator/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/object-enumerator/issues",
+                "source": "https://github.com/sebastianbergmann/object-enumerator/tree/4.0.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T13:12:34+00:00"
+        },
+        {
+            "name": "sebastian/object-reflector",
+            "version": "2.0.4",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/object-reflector.git",
+                "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/object-reflector/zipball/b4f479ebdbf63ac605d183ece17d8d7fe49c15c7",
+                "reference": "b4f479ebdbf63ac605d183ece17d8d7fe49c15c7",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "2.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Allows reflection of object attributes, including inherited and non-public ones",
+            "homepage": "https://github.com/sebastianbergmann/object-reflector/",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/object-reflector/issues",
+                "source": "https://github.com/sebastianbergmann/object-reflector/tree/2.0.4"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-10-26T13:14:26+00:00"
+        },
+        {
+            "name": "sebastian/recursion-context",
+            "version": "4.0.5",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/recursion-context.git",
+                "reference": "e75bd0f07204fec2a0af9b0f3cfe97d05f92efc1"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/recursion-context/zipball/e75bd0f07204fec2a0af9b0f3cfe97d05f92efc1",
+                "reference": "e75bd0f07204fec2a0af9b0f3cfe97d05f92efc1",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "4.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                },
+                {
+                    "name": "Jeff Welch",
+                    "email": "whatthejeff@gmail.com"
+                },
+                {
+                    "name": "Adam Harvey",
+                    "email": "aharvey@php.net"
+                }
+            ],
+            "description": "Provides functionality to recursively process PHP variables",
+            "homepage": "https://github.com/sebastianbergmann/recursion-context",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/recursion-context/issues",
+                "source": "https://github.com/sebastianbergmann/recursion-context/tree/4.0.5"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-02-03T06:07:39+00:00"
+        },
+        {
+            "name": "sebastian/resource-operations",
+            "version": "3.0.3",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/resource-operations.git",
+                "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/resource-operations/zipball/0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8",
+                "reference": "0f4443cb3a1d92ce809899753bc0d5d5a8dd19a8",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.0"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de"
+                }
+            ],
+            "description": "Provides a list of PHP built-in functions that operate on resources",
+            "homepage": "https://www.github.com/sebastianbergmann/resource-operations",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/resource-operations/issues",
+                "source": "https://github.com/sebastianbergmann/resource-operations/tree/3.0.3"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-09-28T06:45:17+00:00"
+        },
+        {
+            "name": "sebastian/type",
+            "version": "3.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/type.git",
+                "reference": "75e2c2a32f5e0b3aef905b9ed0b179b953b3d7c7"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/type/zipball/75e2c2a32f5e0b3aef905b9ed0b179b953b3d7c7",
+                "reference": "75e2c2a32f5e0b3aef905b9ed0b179b953b3d7c7",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^9.5"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.2-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Collection of value objects that represent the types of the PHP type system",
+            "homepage": "https://github.com/sebastianbergmann/type",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/type/issues",
+                "source": "https://github.com/sebastianbergmann/type/tree/3.2.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2023-02-03T06:13:03+00:00"
+        },
+        {
+            "name": "sebastian/version",
+            "version": "3.0.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/sebastianbergmann/version.git",
+                "reference": "c6c1022351a901512170118436c764e473f6de8c"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/sebastianbergmann/version/zipball/c6c1022351a901512170118436c764e473f6de8c",
+                "reference": "c6c1022351a901512170118436c764e473f6de8c",
+                "shasum": ""
+            },
+            "require": {
+                "php": ">=7.3"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.0-dev"
+                }
+            },
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Sebastian Bergmann",
+                    "email": "sebastian@phpunit.de",
+                    "role": "lead"
+                }
+            ],
+            "description": "Library that helps with managing the version number of Git-hosted PHP projects",
+            "homepage": "https://github.com/sebastianbergmann/version",
+            "support": {
+                "issues": "https://github.com/sebastianbergmann/version/issues",
+                "source": "https://github.com/sebastianbergmann/version/tree/3.0.2"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/sebastianbergmann",
+                    "type": "github"
+                }
+            ],
+            "time": "2020-09-28T06:39:44+00:00"
+        },
+        {
+            "name": "squizlabs/php_codesniffer",
+            "version": "3.7.2",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/squizlabs/PHP_CodeSniffer.git",
+                "reference": "ed8e00df0a83aa96acf703f8c2979ff33341f879"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/squizlabs/PHP_CodeSniffer/zipball/ed8e00df0a83aa96acf703f8c2979ff33341f879",
+                "reference": "ed8e00df0a83aa96acf703f8c2979ff33341f879",
+                "shasum": ""
+            },
+            "require": {
+                "ext-simplexml": "*",
+                "ext-tokenizer": "*",
+                "ext-xmlwriter": "*",
+                "php": ">=5.4.0"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^4.0 || ^5.0 || ^6.0 || ^7.0"
+            },
+            "bin": [
+                "bin/phpcs",
+                "bin/phpcbf"
+            ],
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "3.x-dev"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Greg Sherwood",
+                    "role": "lead"
+                }
+            ],
+            "description": "PHP_CodeSniffer tokenizes PHP, JavaScript and CSS files and detects violations of a defined set of coding standards.",
+            "homepage": "https://github.com/squizlabs/PHP_CodeSniffer",
+            "keywords": [
+                "phpcs",
+                "standards",
+                "static analysis"
+            ],
+            "support": {
+                "issues": "https://github.com/squizlabs/PHP_CodeSniffer/issues",
+                "source": "https://github.com/squizlabs/PHP_CodeSniffer",
+                "wiki": "https://github.com/squizlabs/PHP_CodeSniffer/wiki"
+            },
+            "time": "2023-02-22T23:07:41+00:00"
+        },
+        {
+            "name": "theseer/tokenizer",
+            "version": "1.2.1",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/theseer/tokenizer.git",
+                "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/theseer/tokenizer/zipball/34a41e998c2183e22995f158c581e7b5e755ab9e",
+                "reference": "34a41e998c2183e22995f158c581e7b5e755ab9e",
+                "shasum": ""
+            },
+            "require": {
+                "ext-dom": "*",
+                "ext-tokenizer": "*",
+                "ext-xmlwriter": "*",
+                "php": "^7.2 || ^8.0"
+            },
+            "type": "library",
+            "autoload": {
+                "classmap": [
+                    "src/"
+                ]
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "BSD-3-Clause"
+            ],
+            "authors": [
+                {
+                    "name": "Arne Blankerts",
+                    "email": "arne@blankerts.de",
+                    "role": "Developer"
+                }
+            ],
+            "description": "A small library for converting tokenized PHP source code into XML and potentially other formats",
+            "support": {
+                "issues": "https://github.com/theseer/tokenizer/issues",
+                "source": "https://github.com/theseer/tokenizer/tree/1.2.1"
+            },
+            "funding": [
+                {
+                    "url": "https://github.com/theseer",
+                    "type": "github"
+                }
+            ],
+            "time": "2021-07-28T10:34:58+00:00"
+        },
+        {
+            "name": "webmozart/assert",
+            "version": "1.11.0",
+            "source": {
+                "type": "git",
+                "url": "https://github.com/webmozarts/assert.git",
+                "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991"
+            },
+            "dist": {
+                "type": "zip",
+                "url": "https://api.github.com/repos/webmozarts/assert/zipball/11cb2199493b2f8a3b53e7f19068fc6aac760991",
+                "reference": "11cb2199493b2f8a3b53e7f19068fc6aac760991",
+                "shasum": ""
+            },
+            "require": {
+                "ext-ctype": "*",
+                "php": "^7.2 || ^8.0"
+            },
+            "conflict": {
+                "phpstan/phpstan": "<0.12.20",
+                "vimeo/psalm": "<4.6.1 || 4.6.2"
+            },
+            "require-dev": {
+                "phpunit/phpunit": "^8.5.13"
+            },
+            "type": "library",
+            "extra": {
+                "branch-alias": {
+                    "dev-master": "1.10-dev"
+                }
+            },
+            "autoload": {
+                "psr-4": {
+                    "Webmozart\\Assert\\": "src/"
+                }
+            },
+            "notification-url": "https://packagist.org/downloads/",
+            "license": [
+                "MIT"
+            ],
+            "authors": [
+                {
+                    "name": "Bernhard Schussek",
+                    "email": "bschussek@gmail.com"
+                }
+            ],
+            "description": "Assertions to validate method input/output with nice error messages.",
+            "keywords": [
+                "assert",
+                "check",
+                "validate"
+            ],
+            "support": {
+                "issues": "https://github.com/webmozarts/assert/issues",
+                "source": "https://github.com/webmozarts/assert/tree/1.11.0"
+            },
+            "time": "2022-06-03T18:03:27+00:00"
+        }
+    ],
+    "aliases": [],
+    "minimum-stability": "stable",
+    "stability-flags": [],
+    "prefer-stable": false,
+    "prefer-lowest": false,
+    "platform": {
+        "php": "^7.4 || ^8.0",
+        "ext-json": "*"
+    },
+    "platform-dev": [],
+    "plugin-api-version": "2.6.0"
+}
diff --git a/docker-compose.yml b/docker-compose.yml
new file mode 100644
index 0000000..28e6f2b
--- /dev/null
+++ b/docker-compose.yml
@@ -0,0 +1,18 @@
+version: '3.7'
+
+volumes:
+    logs:
+        driver: local
+
+services:
+    slim:
+        image: php:7-alpine
+        working_dir: /var/www
+        command: php -S 0.0.0.0:8080 -t public
+        environment:
+            docker: "true"
+        ports:
+            - "8080:8080"
+        volumes:
+            - .:/var/www
+            - logs:/var/www/logs
diff --git a/phpcs.xml b/phpcs.xml
new file mode 100644
index 0000000..e5c3d04
--- /dev/null
+++ b/phpcs.xml
@@ -0,0 +1,17 @@
+<?xml version="1.0"?>
+<ruleset name="Slim coding standard">
+    <description>Slim coding standard</description>
+
+    <!-- display progress -->
+    <arg value="p"/>
+    <!-- use colors in output -->
+    <arg name="colors"/>
+
+    <!-- inherit rules from: -->
+    <rule ref="PSR12"/>
+    <rule ref="Generic.Arrays.DisallowLongArraySyntax"/>
+
+    <!-- Paths to check -->
+    <file>src</file>
+    <file>tests</file>
+</ruleset>
\ No newline at end of file
diff --git a/phpstan.neon.dist b/phpstan.neon.dist
new file mode 100644
index 0000000..2e09595
--- /dev/null
+++ b/phpstan.neon.dist
@@ -0,0 +1,4 @@
+parameters:
+  level: 4
+  paths:
+    - src
diff --git a/phpunit.xml b/phpunit.xml
new file mode 100644
index 0000000..f830400
--- /dev/null
+++ b/phpunit.xml
@@ -0,0 +1,27 @@
+<phpunit
+    xmlns:xsi="http://www.w3.org/2001/XMLSchema-instance"
+    xsi:noNamespaceSchemaLocation="http://schema.phpunit.de/7.1/phpunit.xsd"
+    backupGlobals="false"
+    backupStaticAttributes="false"
+    beStrictAboutTestsThatDoNotTestAnything="true"
+    beStrictAboutChangesToGlobalState="true"
+    beStrictAboutOutputDuringTests="true"
+    colors="true"
+    convertErrorsToExceptions="true"
+    convertNoticesToExceptions="true"
+    convertWarningsToExceptions="true"
+    processIsolation="false"
+    stopOnFailure="false"
+    bootstrap="tests/bootstrap.php"
+>
+    <testsuites>
+        <testsuite name="Test Suite">
+            <directory>./tests/</directory>
+        </testsuite>
+    </testsuites>
+    <filter>
+        <whitelist processUncoveredFilesFromWhitelist="true">
+            <directory suffix=".php">./src/</directory>
+        </whitelist>
+    </filter>
+</phpunit>
diff --git a/public/.htaccess b/public/.htaccess
new file mode 100644
index 0000000..fe74ec5
--- /dev/null
+++ b/public/.htaccess
@@ -0,0 +1,34 @@
+Options All -Indexes
+
+<Files .htaccess>
+order allow,deny
+deny from all
+</Files>
+
+<IfModule mod_rewrite.c>
+  RewriteEngine On
+
+  # Redirect to HTTPS
+  # RewriteEngine On
+  # RewriteCond %{HTTPS} off
+  # RewriteRule ^(.*)$ https://%{HTTP_HOST}%{REQUEST_URI} [L,R=301]
+
+  # Some hosts may require you to use the `RewriteBase` directive.
+  # Determine the RewriteBase automatically and set it as environment variable.
+  # If you are using Apache aliases to do mass virtual hosting or installed the
+  # project in a subdirectory, the base path will be prepended to allow proper
+  # resolution of the index.php file and to redirect to the correct URI. It will
+  # work in environments without path prefix as well, providing a safe, one-size
+  # fits all solution. But as you do not need it in this case, you can comment
+  # the following 2 lines to eliminate the overhead.
+  RewriteCond %{REQUEST_URI}::$1 ^(/.+)/(.*)::\2$
+  RewriteRule ^(.*) - [E=BASE:%1]
+  
+  # If the above doesn't work you might need to set the `RewriteBase` directive manually, it should be the
+  # absolute physical path to the directory that contains this htaccess file.
+  # RewriteBase /
+
+  RewriteCond %{REQUEST_FILENAME} !-d
+  RewriteCond %{REQUEST_FILENAME} !-f
+  RewriteRule ^ index.php [QSA,L]
+</IfModule>
diff --git a/public/index.php b/public/index.php
new file mode 100644
index 0000000..bc583c8
--- /dev/null
+++ b/public/index.php
@@ -0,0 +1,82 @@
+<?php
+
+declare(strict_types=1);
+
+use App\Application\Handlers\HttpErrorHandler;
+use App\Application\Handlers\ShutdownHandler;
+use App\Application\ResponseEmitter\ResponseEmitter;
+use App\Application\Settings\SettingsInterface;
+use DI\ContainerBuilder;
+use Slim\Factory\AppFactory;
+use Slim\Factory\ServerRequestCreatorFactory;
+
+require __DIR__ . '/../vendor/autoload.php';
+
+// Instantiate PHP-DI ContainerBuilder
+$containerBuilder = new ContainerBuilder();
+
+if (false) { // Should be set to true in production
+	$containerBuilder->enableCompilation(__DIR__ . '/../var/cache');
+}
+
+// Set up settings
+$settings = require __DIR__ . '/../app/settings.php';
+$settings($containerBuilder);
+
+// Set up dependencies
+$dependencies = require __DIR__ . '/../app/dependencies.php';
+$dependencies($containerBuilder);
+
+// Set up repositories
+$repositories = require __DIR__ . '/../app/repositories.php';
+$repositories($containerBuilder);
+
+// Build PHP-DI Container instance
+$container = $containerBuilder->build();
+
+// Instantiate the app
+AppFactory::setContainer($container);
+$app = AppFactory::create();
+$callableResolver = $app->getCallableResolver();
+
+// Register middleware
+$middleware = require __DIR__ . '/../app/middleware.php';
+$middleware($app);
+
+// Register routes
+$routes = require __DIR__ . '/../app/routes.php';
+$routes($app);
+
+/** @var SettingsInterface $settings */
+$settings = $container->get(SettingsInterface::class);
+
+$displayErrorDetails = $settings->get('displayErrorDetails');
+$logError = $settings->get('logError');
+$logErrorDetails = $settings->get('logErrorDetails');
+
+// Create Request object from globals
+$serverRequestCreator = ServerRequestCreatorFactory::create();
+$request = $serverRequestCreator->createServerRequestFromGlobals();
+
+// Create Error Handler
+$responseFactory = $app->getResponseFactory();
+$errorHandler = new HttpErrorHandler($callableResolver, $responseFactory);
+
+// Create Shutdown Handler
+$shutdownHandler = new ShutdownHandler($request, $errorHandler, $displayErrorDetails);
+register_shutdown_function($shutdownHandler);
+
+// Add Routing Middleware
+$app->addRoutingMiddleware();
+
+// Add Body Parsing Middleware
+$app->addBodyParsingMiddleware();
+
+// Add Error Middleware
+$errorMiddleware = $app->addErrorMiddleware($displayErrorDetails, $logError, $logErrorDetails);
+$errorMiddleware->setDefaultErrorHandler($errorHandler);
+
+// Run App & Emit Response
+$response = $app->handle($request);
+$responseEmitter = new ResponseEmitter();
+$responseEmitter->emit($response);
diff --git a/src/Application/Actions/Action.php b/src/Application/Actions/Action.php
new file mode 100644
index 0000000..1021c20
--- /dev/null
+++ b/src/Application/Actions/Action.php
@@ -0,0 +1,92 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use App\Domain\DomainException\DomainRecordNotFoundException;
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Psr\Log\LoggerInterface;
+use Slim\Exception\HttpBadRequestException;
+use Slim\Exception\HttpNotFoundException;
+
+abstract class Action
+{
+    protected LoggerInterface $logger;
+
+    protected Request $request;
+
+    protected Response $response;
+
+    protected array $args;
+
+    public function __construct(LoggerInterface $logger)
+    {
+        $this->logger = $logger;
+    }
+
+    /**
+     * @throws HttpNotFoundException
+     * @throws HttpBadRequestException
+     */
+    public function __invoke(Request $request, Response $response, array $args): Response
+    {
+        $this->request = $request;
+        $this->response = $response;
+        $this->args = $args;
+
+        try {
+            return $this->action();
+        } catch (DomainRecordNotFoundException $e) {
+            throw new HttpNotFoundException($this->request, $e->getMessage());
+        }
+    }
+
+    /**
+     * @throws DomainRecordNotFoundException
+     * @throws HttpBadRequestException
+     */
+    abstract protected function action(): Response;
+
+    /**
+     * @return array|object
+     */
+    protected function getFormData()
+    {
+        return $this->request->getParsedBody();
+    }
+
+    /**
+     * @return mixed
+     * @throws HttpBadRequestException
+     */
+    protected function resolveArg(string $name)
+    {
+        if (!isset($this->args[$name])) {
+            throw new HttpBadRequestException($this->request, "Could not resolve argument `{$name}`.");
+        }
+
+        return $this->args[$name];
+    }
+
+    /**
+     * @param array|object|null $data
+     */
+    protected function respondWithData($data = null, int $statusCode = 200): Response
+    {
+        $payload = new ActionPayload($statusCode, $data);
+
+        return $this->respond($payload);
+    }
+
+    protected function respond(ActionPayload $payload): Response
+    {
+        $json = json_encode($payload, JSON_PRETTY_PRINT);
+        $this->response->getBody()->write($json);
+
+        return $this->response
+                    ->withHeader('Content-Type', 'application/json')
+                    ->withStatus($payload->getStatusCode());
+    }
+}
diff --git a/src/Application/Actions/ActionError.php b/src/Application/Actions/ActionError.php
new file mode 100644
index 0000000..3a81cc5
--- /dev/null
+++ b/src/Application/Actions/ActionError.php
@@ -0,0 +1,61 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use JsonSerializable;
+
+class ActionError implements JsonSerializable
+{
+    public const BAD_REQUEST = 'BAD_REQUEST';
+    public const INSUFFICIENT_PRIVILEGES = 'INSUFFICIENT_PRIVILEGES';
+    public const NOT_ALLOWED = 'NOT_ALLOWED';
+    public const NOT_IMPLEMENTED = 'NOT_IMPLEMENTED';
+    public const RESOURCE_NOT_FOUND = 'RESOURCE_NOT_FOUND';
+    public const SERVER_ERROR = 'SERVER_ERROR';
+    public const UNAUTHENTICATED = 'UNAUTHENTICATED';
+    public const VALIDATION_ERROR = 'VALIDATION_ERROR';
+    public const VERIFICATION_ERROR = 'VERIFICATION_ERROR';
+
+    private string $type;
+
+    private ?string $description;
+
+    public function __construct(string $type, ?string $description = null)
+    {
+        $this->type = $type;
+        $this->description = $description;
+    }
+
+    public function getType(): string
+    {
+        return $this->type;
+    }
+
+    public function setType(string $type): self
+    {
+        $this->type = $type;
+        return $this;
+    }
+
+    public function getDescription(): ?string
+    {
+        return $this->description;
+    }
+
+    public function setDescription(?string $description = null): self
+    {
+        $this->description = $description;
+        return $this;
+    }
+
+    #[\ReturnTypeWillChange]
+    public function jsonSerialize(): array
+    {
+        return [
+            'type' => $this->type,
+            'description' => $this->description,
+        ];
+    }
+}
diff --git a/src/Application/Actions/ActionPayload.php b/src/Application/Actions/ActionPayload.php
new file mode 100644
index 0000000..cbf5110
--- /dev/null
+++ b/src/Application/Actions/ActionPayload.php
@@ -0,0 +1,63 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions;
+
+use JsonSerializable;
+
+class ActionPayload implements JsonSerializable
+{
+    private int $statusCode;
+
+    /**
+     * @var array|object|null
+     */
+    private $data;
+
+    private ?ActionError $error;
+
+    public function __construct(
+        int $statusCode = 200,
+        $data = null,
+        ?ActionError $error = null
+    ) {
+        $this->statusCode = $statusCode;
+        $this->data = $data;
+        $this->error = $error;
+    }
+
+    public function getStatusCode(): int
+    {
+        return $this->statusCode;
+    }
+
+    /**
+     * @return array|null|object
+     */
+    public function getData()
+    {
+        return $this->data;
+    }
+
+    public function getError(): ?ActionError
+    {
+        return $this->error;
+    }
+
+    #[\ReturnTypeWillChange]
+    public function jsonSerialize(): array
+    {
+        $payload = [
+            'statusCode' => $this->statusCode,
+        ];
+
+        if ($this->data !== null) {
+            $payload['data'] = $this->data;
+        } elseif ($this->error !== null) {
+            $payload['error'] = $this->error;
+        }
+
+        return $payload;
+    }
+}
diff --git a/src/Application/Actions/User/ListUsersAction.php b/src/Application/Actions/User/ListUsersAction.php
new file mode 100644
index 0000000..7ca74d7
--- /dev/null
+++ b/src/Application/Actions/User/ListUsersAction.php
@@ -0,0 +1,22 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use Psr\Http\Message\ResponseInterface as Response;
+
+class ListUsersAction extends UserAction
+{
+    /**
+     * {@inheritdoc}
+     */
+    protected function action(): Response
+    {
+        $users = $this->userRepository->findAll();
+
+        $this->logger->info("Users list was viewed.");
+
+        return $this->respondWithData($users);
+    }
+}
diff --git a/src/Application/Actions/User/UserAction.php b/src/Application/Actions/User/UserAction.php
new file mode 100644
index 0000000..4ea2d8c
--- /dev/null
+++ b/src/Application/Actions/User/UserAction.php
@@ -0,0 +1,20 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use App\Application\Actions\Action;
+use App\Domain\User\UserRepository;
+use Psr\Log\LoggerInterface;
+
+abstract class UserAction extends Action
+{
+    protected UserRepository $userRepository;
+
+    public function __construct(LoggerInterface $logger, UserRepository $userRepository)
+    {
+        parent::__construct($logger);
+        $this->userRepository = $userRepository;
+    }
+}
diff --git a/src/Application/Actions/User/ViewUserAction.php b/src/Application/Actions/User/ViewUserAction.php
new file mode 100644
index 0000000..711cf0a
--- /dev/null
+++ b/src/Application/Actions/User/ViewUserAction.php
@@ -0,0 +1,23 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Actions\User;
+
+use Psr\Http\Message\ResponseInterface as Response;
+
+class ViewUserAction extends UserAction
+{
+    /**
+     * {@inheritdoc}
+     */
+    protected function action(): Response
+    {
+        $userId = (int) $this->resolveArg('id');
+        $user = $this->userRepository->findUserOfId($userId);
+
+        $this->logger->info("User of id `${userId}` was viewed.");
+
+        return $this->respondWithData($user);
+    }
+}
diff --git a/src/Application/Handlers/HttpErrorHandler.php b/src/Application/Handlers/HttpErrorHandler.php
new file mode 100644
index 0000000..64e02b1
--- /dev/null
+++ b/src/Application/Handlers/HttpErrorHandler.php
@@ -0,0 +1,69 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Handlers;
+
+use App\Application\Actions\ActionError;
+use App\Application\Actions\ActionPayload;
+use Psr\Http\Message\ResponseInterface as Response;
+use Slim\Exception\HttpBadRequestException;
+use Slim\Exception\HttpException;
+use Slim\Exception\HttpForbiddenException;
+use Slim\Exception\HttpMethodNotAllowedException;
+use Slim\Exception\HttpNotFoundException;
+use Slim\Exception\HttpNotImplementedException;
+use Slim\Exception\HttpUnauthorizedException;
+use Slim\Handlers\ErrorHandler as SlimErrorHandler;
+use Throwable;
+
+class HttpErrorHandler extends SlimErrorHandler
+{
+    /**
+     * @inheritdoc
+     */
+    protected function respond(): Response
+    {
+        $exception = $this->exception;
+        $statusCode = 500;
+        $error = new ActionError(
+            ActionError::SERVER_ERROR,
+            'An internal error has occurred while processing your request.'
+        );
+
+        if ($exception instanceof HttpException) {
+            $statusCode = $exception->getCode();
+            $error->setDescription($exception->getMessage());
+
+            if ($exception instanceof HttpNotFoundException) {
+                $error->setType(ActionError::RESOURCE_NOT_FOUND);
+            } elseif ($exception instanceof HttpMethodNotAllowedException) {
+                $error->setType(ActionError::NOT_ALLOWED);
+            } elseif ($exception instanceof HttpUnauthorizedException) {
+                $error->setType(ActionError::UNAUTHENTICATED);
+            } elseif ($exception instanceof HttpForbiddenException) {
+                $error->setType(ActionError::INSUFFICIENT_PRIVILEGES);
+            } elseif ($exception instanceof HttpBadRequestException) {
+                $error->setType(ActionError::BAD_REQUEST);
+            } elseif ($exception instanceof HttpNotImplementedException) {
+                $error->setType(ActionError::NOT_IMPLEMENTED);
+            }
+        }
+
+        if (
+            !($exception instanceof HttpException)
+            && $exception instanceof Throwable
+            && $this->displayErrorDetails
+        ) {
+            $error->setDescription($exception->getMessage());
+        }
+
+        $payload = new ActionPayload($statusCode, null, $error);
+        $encodedPayload = json_encode($payload, JSON_PRETTY_PRINT);
+
+        $response = $this->responseFactory->createResponse($statusCode);
+        $response->getBody()->write($encodedPayload);
+
+        return $response->withHeader('Content-Type', 'application/json');
+    }
+}
diff --git a/src/Application/Handlers/ShutdownHandler.php b/src/Application/Handlers/ShutdownHandler.php
new file mode 100644
index 0000000..dc54b27
--- /dev/null
+++ b/src/Application/Handlers/ShutdownHandler.php
@@ -0,0 +1,74 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Handlers;
+
+use App\Application\ResponseEmitter\ResponseEmitter;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\Exception\HttpInternalServerErrorException;
+
+class ShutdownHandler
+{
+    private Request $request;
+
+    private HttpErrorHandler $errorHandler;
+
+    private bool $displayErrorDetails;
+
+    public function __construct(
+        Request $request,
+        HttpErrorHandler $errorHandler,
+        bool $displayErrorDetails
+    ) {
+        $this->request = $request;
+        $this->errorHandler = $errorHandler;
+        $this->displayErrorDetails = $displayErrorDetails;
+    }
+
+    public function __invoke()
+    {
+        $error = error_get_last();
+        if ($error) {
+            $errorFile = $error['file'];
+            $errorLine = $error['line'];
+            $errorMessage = $error['message'];
+            $errorType = $error['type'];
+            $message = 'An error while processing your request. Please try again later.';
+
+            if ($this->displayErrorDetails) {
+                switch ($errorType) {
+                    case E_USER_ERROR:
+                        $message = "FATAL ERROR: {$errorMessage}. ";
+                        $message .= " on line {$errorLine} in file {$errorFile}.";
+                        break;
+
+                    case E_USER_WARNING:
+                        $message = "WARNING: {$errorMessage}";
+                        break;
+
+                    case E_USER_NOTICE:
+                        $message = "NOTICE: {$errorMessage}";
+                        break;
+
+                    default:
+                        $message = "ERROR: {$errorMessage}";
+                        $message .= " on line {$errorLine} in file {$errorFile}.";
+                        break;
+                }
+            }
+
+            $exception = new HttpInternalServerErrorException($this->request, $message);
+            $response = $this->errorHandler->__invoke(
+                $this->request,
+                $exception,
+                $this->displayErrorDetails,
+                false,
+                false,
+            );
+
+            $responseEmitter = new ResponseEmitter();
+            $responseEmitter->emit($response);
+        }
+    }
+}
diff --git a/src/Application/Middleware/SessionMiddleware.php b/src/Application/Middleware/SessionMiddleware.php
new file mode 100644
index 0000000..d7dc923
--- /dev/null
+++ b/src/Application/Middleware/SessionMiddleware.php
@@ -0,0 +1,26 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Middleware;
+
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Psr\Http\Server\MiddlewareInterface as Middleware;
+use Psr\Http\Server\RequestHandlerInterface as RequestHandler;
+
+class SessionMiddleware implements Middleware
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function process(Request $request, RequestHandler $handler): Response
+    {
+        if (isset($_SERVER['HTTP_AUTHORIZATION'])) {
+            session_start();
+            $request = $request->withAttribute('session', $_SESSION);
+        }
+
+        return $handler->handle($request);
+    }
+}
diff --git a/src/Application/ResponseEmitter/ResponseEmitter.php b/src/Application/ResponseEmitter/ResponseEmitter.php
new file mode 100644
index 0000000..8a27ae1
--- /dev/null
+++ b/src/Application/ResponseEmitter/ResponseEmitter.php
@@ -0,0 +1,38 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\ResponseEmitter;
+
+use Psr\Http\Message\ResponseInterface;
+use Slim\ResponseEmitter as SlimResponseEmitter;
+
+class ResponseEmitter extends SlimResponseEmitter
+{
+    /**
+     * {@inheritdoc}
+     */
+    public function emit(ResponseInterface $response): void
+    {
+        // This variable should be set to the allowed host from which your API can be accessed with
+        $origin = $_SERVER['HTTP_ORIGIN'] ?? '';
+
+        $response = $response
+            ->withHeader('Access-Control-Allow-Credentials', 'true')
+            ->withHeader('Access-Control-Allow-Origin', $origin)
+            ->withHeader(
+                'Access-Control-Allow-Headers',
+                'X-Requested-With, Content-Type, Accept, Origin, Authorization',
+            )
+            ->withHeader('Access-Control-Allow-Methods', 'GET, POST, PUT, PATCH, DELETE, OPTIONS')
+            ->withHeader('Cache-Control', 'no-store, no-cache, must-revalidate, max-age=0')
+            ->withAddedHeader('Cache-Control', 'post-check=0, pre-check=0')
+            ->withHeader('Pragma', 'no-cache');
+
+        if (ob_get_contents()) {
+            ob_clean();
+        }
+
+        parent::emit($response);
+    }
+}
diff --git a/src/Application/Settings/Settings.php b/src/Application/Settings/Settings.php
new file mode 100644
index 0000000..6da55e4
--- /dev/null
+++ b/src/Application/Settings/Settings.php
@@ -0,0 +1,23 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Settings;
+
+class Settings implements SettingsInterface
+{
+    private array $settings;
+
+    public function __construct(array $settings)
+    {
+        $this->settings = $settings;
+    }
+
+    /**
+     * @return mixed
+     */
+    public function get(string $key = '')
+    {
+        return (empty($key)) ? $this->settings : $this->settings[$key];
+    }
+}
diff --git a/src/Application/Settings/SettingsInterface.php b/src/Application/Settings/SettingsInterface.php
new file mode 100644
index 0000000..557d98b
--- /dev/null
+++ b/src/Application/Settings/SettingsInterface.php
@@ -0,0 +1,14 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Application\Settings;
+
+interface SettingsInterface
+{
+    /**
+     * @param string $key
+     * @return mixed
+     */
+    public function get(string $key = '');
+}
diff --git a/src/Domain/DomainException/DomainException.php b/src/Domain/DomainException/DomainException.php
new file mode 100644
index 0000000..51c2795
--- /dev/null
+++ b/src/Domain/DomainException/DomainException.php
@@ -0,0 +1,11 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Domain\DomainException;
+
+use Exception;
+
+abstract class DomainException extends Exception
+{
+}
diff --git a/src/Domain/DomainException/DomainRecordNotFoundException.php b/src/Domain/DomainException/DomainRecordNotFoundException.php
new file mode 100644
index 0000000..f3859a3
--- /dev/null
+++ b/src/Domain/DomainException/DomainRecordNotFoundException.php
@@ -0,0 +1,9 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Domain\DomainException;
+
+class DomainRecordNotFoundException extends DomainException
+{
+}
diff --git a/src/Domain/User/User.php b/src/Domain/User/User.php
new file mode 100644
index 0000000..217bb9e
--- /dev/null
+++ b/src/Domain/User/User.php
@@ -0,0 +1,57 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+use JsonSerializable;
+
+class User implements JsonSerializable
+{
+    private ?int $id;
+
+    private string $username;
+
+    private string $firstName;
+
+    private string $lastName;
+
+    public function __construct(?int $id, string $username, string $firstName, string $lastName)
+    {
+        $this->id = $id;
+        $this->username = strtolower($username);
+        $this->firstName = ucfirst($firstName);
+        $this->lastName = ucfirst($lastName);
+    }
+
+    public function getId(): ?int
+    {
+        return $this->id;
+    }
+
+    public function getUsername(): string
+    {
+        return $this->username;
+    }
+
+    public function getFirstName(): string
+    {
+        return $this->firstName;
+    }
+
+    public function getLastName(): string
+    {
+        return $this->lastName;
+    }
+
+    #[\ReturnTypeWillChange]
+    public function jsonSerialize(): array
+    {
+        return [
+            'id' => $this->id,
+            'username' => $this->username,
+            'firstName' => $this->firstName,
+            'lastName' => $this->lastName,
+        ];
+    }
+}
diff --git a/src/Domain/User/UserNotFoundException.php b/src/Domain/User/UserNotFoundException.php
new file mode 100644
index 0000000..ae3d11e
--- /dev/null
+++ b/src/Domain/User/UserNotFoundException.php
@@ -0,0 +1,12 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+use App\Domain\DomainException\DomainRecordNotFoundException;
+
+class UserNotFoundException extends DomainRecordNotFoundException
+{
+    public $message = 'The user you requested does not exist.';
+}
diff --git a/src/Domain/User/UserRepository.php b/src/Domain/User/UserRepository.php
new file mode 100644
index 0000000..099b2bf
--- /dev/null
+++ b/src/Domain/User/UserRepository.php
@@ -0,0 +1,20 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Domain\User;
+
+interface UserRepository
+{
+    /**
+     * @return User[]
+     */
+    public function findAll(): array;
+
+    /**
+     * @param int $id
+     * @return User
+     * @throws UserNotFoundException
+     */
+    public function findUserOfId(int $id): User;
+}
diff --git a/src/Infrastructure/Persistence/User/InMemoryUserRepository.php b/src/Infrastructure/Persistence/User/InMemoryUserRepository.php
new file mode 100644
index 0000000..b85a74f
--- /dev/null
+++ b/src/Infrastructure/Persistence/User/InMemoryUserRepository.php
@@ -0,0 +1,51 @@
+<?php
+
+declare(strict_types=1);
+
+namespace App\Infrastructure\Persistence\User;
+
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Domain\User\UserRepository;
+
+class InMemoryUserRepository implements UserRepository
+{
+    /**
+     * @var User[]
+     */
+    private array $users;
+
+    /**
+     * @param User[]|null $users
+     */
+    public function __construct(array $users = null)
+    {
+        $this->users = $users ?? [
+            1 => new User(1, 'bill.gates', 'Bill', 'Gates'),
+            2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'),
+            3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'),
+            4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'),
+            5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'),
+        ];
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function findAll(): array
+    {
+        return array_values($this->users);
+    }
+
+    /**
+     * {@inheritdoc}
+     */
+    public function findUserOfId(int $id): User
+    {
+        if (!isset($this->users[$id])) {
+            throw new UserNotFoundException();
+        }
+
+        return $this->users[$id];
+    }
+}
diff --git a/tests/Application/Actions/ActionTest.php b/tests/Application/Actions/ActionTest.php
new file mode 100644
index 0000000..9881c68
--- /dev/null
+++ b/tests/Application/Actions/ActionTest.php
@@ -0,0 +1,79 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests\Application\Actions;
+
+use App\Application\Actions\Action;
+use App\Application\Actions\ActionPayload;
+use DateTimeImmutable;
+use Psr\Http\Message\ResponseInterface as Response;
+use Psr\Log\LoggerInterface;
+use Tests\TestCase;
+
+class ActionTest extends TestCase
+{
+    public function testActionSetsHttpCodeInRespond()
+    {
+        $app = $this->getAppInstance();
+        $container = $app->getContainer();
+        $logger = $container->get(LoggerInterface::class);
+
+        $testAction = new class ($logger) extends Action {
+            public function __construct(
+                LoggerInterface $loggerInterface
+            ) {
+                parent::__construct($loggerInterface);
+            }
+
+            public function action(): Response
+            {
+                return $this->respond(
+                    new ActionPayload(
+                        202,
+                        [
+                            'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM)
+                        ]
+                    )
+                );
+            }
+        };
+
+        $app->get('/test-action-response-code', $testAction);
+        $request = $this->createRequest('GET', '/test-action-response-code');
+        $response = $app->handle($request);
+
+        $this->assertEquals(202, $response->getStatusCode());
+    }
+
+    public function testActionSetsHttpCodeRespondData()
+    {
+        $app = $this->getAppInstance();
+        $container = $app->getContainer();
+        $logger = $container->get(LoggerInterface::class);
+
+        $testAction = new class ($logger) extends Action {
+            public function __construct(
+                LoggerInterface $loggerInterface
+            ) {
+                parent::__construct($loggerInterface);
+            }
+
+            public function action(): Response
+            {
+                return $this->respondWithData(
+                    [
+                        'willBeDoneAt' => (new DateTimeImmutable())->format(DateTimeImmutable::ATOM)
+                    ],
+                    202
+                );
+            }
+        };
+
+        $app->get('/test-action-response-code', $testAction);
+        $request = $this->createRequest('GET', '/test-action-response-code');
+        $response = $app->handle($request);
+
+        $this->assertEquals(202, $response->getStatusCode());
+    }
+}
diff --git a/tests/Application/Actions/User/ListUserActionTest.php b/tests/Application/Actions/User/ListUserActionTest.php
new file mode 100644
index 0000000..fcf3222
--- /dev/null
+++ b/tests/Application/Actions/User/ListUserActionTest.php
@@ -0,0 +1,41 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests\Application\Actions\User;
+
+use App\Application\Actions\ActionPayload;
+use App\Domain\User\UserRepository;
+use App\Domain\User\User;
+use DI\Container;
+use Tests\TestCase;
+
+class ListUserActionTest extends TestCase
+{
+    public function testAction()
+    {
+        $app = $this->getAppInstance();
+
+        /** @var Container $container */
+        $container = $app->getContainer();
+
+        $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+        $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+        $userRepositoryProphecy
+            ->findAll()
+            ->willReturn([$user])
+            ->shouldBeCalledOnce();
+
+        $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+        $request = $this->createRequest('GET', '/users');
+        $response = $app->handle($request);
+
+        $payload = (string) $response->getBody();
+        $expectedPayload = new ActionPayload(200, [$user]);
+        $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+        $this->assertEquals($serializedPayload, $payload);
+    }
+}
diff --git a/tests/Application/Actions/User/ViewUserActionTest.php b/tests/Application/Actions/User/ViewUserActionTest.php
new file mode 100644
index 0000000..785b6c6
--- /dev/null
+++ b/tests/Application/Actions/User/ViewUserActionTest.php
@@ -0,0 +1,80 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests\Application\Actions\User;
+
+use App\Application\Actions\ActionError;
+use App\Application\Actions\ActionPayload;
+use App\Application\Handlers\HttpErrorHandler;
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Domain\User\UserRepository;
+use DI\Container;
+use Slim\Middleware\ErrorMiddleware;
+use Tests\TestCase;
+
+class ViewUserActionTest extends TestCase
+{
+    public function testAction()
+    {
+        $app = $this->getAppInstance();
+
+        /** @var Container $container */
+        $container = $app->getContainer();
+
+        $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+        $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+        $userRepositoryProphecy
+            ->findUserOfId(1)
+            ->willReturn($user)
+            ->shouldBeCalledOnce();
+
+        $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+        $request = $this->createRequest('GET', '/users/1');
+        $response = $app->handle($request);
+
+        $payload = (string) $response->getBody();
+        $expectedPayload = new ActionPayload(200, $user);
+        $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+        $this->assertEquals($serializedPayload, $payload);
+    }
+
+    public function testActionThrowsUserNotFoundException()
+    {
+        $app = $this->getAppInstance();
+
+        $callableResolver = $app->getCallableResolver();
+        $responseFactory = $app->getResponseFactory();
+
+        $errorHandler = new HttpErrorHandler($callableResolver, $responseFactory);
+        $errorMiddleware = new ErrorMiddleware($callableResolver, $responseFactory, true, false, false);
+        $errorMiddleware->setDefaultErrorHandler($errorHandler);
+
+        $app->add($errorMiddleware);
+
+        /** @var Container $container */
+        $container = $app->getContainer();
+
+        $userRepositoryProphecy = $this->prophesize(UserRepository::class);
+        $userRepositoryProphecy
+            ->findUserOfId(1)
+            ->willThrow(new UserNotFoundException())
+            ->shouldBeCalledOnce();
+
+        $container->set(UserRepository::class, $userRepositoryProphecy->reveal());
+
+        $request = $this->createRequest('GET', '/users/1');
+        $response = $app->handle($request);
+
+        $payload = (string) $response->getBody();
+        $expectedError = new ActionError(ActionError::RESOURCE_NOT_FOUND, 'The user you requested does not exist.');
+        $expectedPayload = new ActionPayload(404, null, $expectedError);
+        $serializedPayload = json_encode($expectedPayload, JSON_PRETTY_PRINT);
+
+        $this->assertEquals($serializedPayload, $payload);
+    }
+}
diff --git a/tests/Domain/User/UserTest.php b/tests/Domain/User/UserTest.php
new file mode 100644
index 0000000..36f4925
--- /dev/null
+++ b/tests/Domain/User/UserTest.php
@@ -0,0 +1,60 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests\Domain\User;
+
+use App\Domain\User\User;
+use Tests\TestCase;
+
+class UserTest extends TestCase
+{
+    public function userProvider(): array
+    {
+        return [
+            [1, 'bill.gates', 'Bill', 'Gates'],
+            [2, 'steve.jobs', 'Steve', 'Jobs'],
+            [3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'],
+            [4, 'evan.spiegel', 'Evan', 'Spiegel'],
+            [5, 'jack.dorsey', 'Jack', 'Dorsey'],
+        ];
+    }
+
+    /**
+     * @dataProvider userProvider
+     * @param int    $id
+     * @param string $username
+     * @param string $firstName
+     * @param string $lastName
+     */
+    public function testGetters(int $id, string $username, string $firstName, string $lastName)
+    {
+        $user = new User($id, $username, $firstName, $lastName);
+
+        $this->assertEquals($id, $user->getId());
+        $this->assertEquals($username, $user->getUsername());
+        $this->assertEquals($firstName, $user->getFirstName());
+        $this->assertEquals($lastName, $user->getLastName());
+    }
+
+    /**
+     * @dataProvider userProvider
+     * @param int    $id
+     * @param string $username
+     * @param string $firstName
+     * @param string $lastName
+     */
+    public function testJsonSerialize(int $id, string $username, string $firstName, string $lastName)
+    {
+        $user = new User($id, $username, $firstName, $lastName);
+
+        $expectedPayload = json_encode([
+            'id' => $id,
+            'username' => $username,
+            'firstName' => $firstName,
+            'lastName' => $lastName,
+        ]);
+
+        $this->assertEquals($expectedPayload, json_encode($user));
+    }
+}
diff --git a/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php
new file mode 100644
index 0000000..6b51b0c
--- /dev/null
+++ b/tests/Infrastructure/Persistence/User/InMemoryUserRepositoryTest.php
@@ -0,0 +1,53 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests\Infrastructure\Persistence\User;
+
+use App\Domain\User\User;
+use App\Domain\User\UserNotFoundException;
+use App\Infrastructure\Persistence\User\InMemoryUserRepository;
+use Tests\TestCase;
+
+class InMemoryUserRepositoryTest extends TestCase
+{
+    public function testFindAll()
+    {
+        $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+        $userRepository = new InMemoryUserRepository([1 => $user]);
+
+        $this->assertEquals([$user], $userRepository->findAll());
+    }
+
+    public function testFindAllUsersByDefault()
+    {
+        $users = [
+            1 => new User(1, 'bill.gates', 'Bill', 'Gates'),
+            2 => new User(2, 'steve.jobs', 'Steve', 'Jobs'),
+            3 => new User(3, 'mark.zuckerberg', 'Mark', 'Zuckerberg'),
+            4 => new User(4, 'evan.spiegel', 'Evan', 'Spiegel'),
+            5 => new User(5, 'jack.dorsey', 'Jack', 'Dorsey'),
+        ];
+
+        $userRepository = new InMemoryUserRepository();
+
+        $this->assertEquals(array_values($users), $userRepository->findAll());
+    }
+
+    public function testFindUserOfId()
+    {
+        $user = new User(1, 'bill.gates', 'Bill', 'Gates');
+
+        $userRepository = new InMemoryUserRepository([1 => $user]);
+
+        $this->assertEquals($user, $userRepository->findUserOfId(1));
+    }
+
+    public function testFindUserOfIdThrowsNotFoundException()
+    {
+        $userRepository = new InMemoryUserRepository([]);
+        $this->expectException(UserNotFoundException::class);
+        $userRepository->findUserOfId(1);
+    }
+}
diff --git a/tests/TestCase.php b/tests/TestCase.php
new file mode 100644
index 0000000..a55f09d
--- /dev/null
+++ b/tests/TestCase.php
@@ -0,0 +1,90 @@
+<?php
+
+declare(strict_types=1);
+
+namespace Tests;
+
+use DI\ContainerBuilder;
+use Exception;
+use PHPUnit\Framework\TestCase as PHPUnit_TestCase;
+use Prophecy\PhpUnit\ProphecyTrait;
+use Psr\Http\Message\ServerRequestInterface as Request;
+use Slim\App;
+use Slim\Factory\AppFactory;
+use Slim\Psr7\Factory\StreamFactory;
+use Slim\Psr7\Headers;
+use Slim\Psr7\Request as SlimRequest;
+use Slim\Psr7\Uri;
+
+class TestCase extends PHPUnit_TestCase
+{
+    use ProphecyTrait;
+
+    /**
+     * @return App
+     * @throws Exception
+     */
+    protected function getAppInstance(): App
+    {
+        // Instantiate PHP-DI ContainerBuilder
+        $containerBuilder = new ContainerBuilder();
+
+        // Container intentionally not compiled for tests.
+
+        // Set up settings
+        $settings = require __DIR__ . '/../app/settings.php';
+        $settings($containerBuilder);
+
+        // Set up dependencies
+        $dependencies = require __DIR__ . '/../app/dependencies.php';
+        $dependencies($containerBuilder);
+
+        // Set up repositories
+        $repositories = require __DIR__ . '/../app/repositories.php';
+        $repositories($containerBuilder);
+
+        // Build PHP-DI Container instance
+        $container = $containerBuilder->build();
+
+        // Instantiate the app
+        AppFactory::setContainer($container);
+        $app = AppFactory::create();
+
+        // Register middleware
+        $middleware = require __DIR__ . '/../app/middleware.php';
+        $middleware($app);
+
+        // Register routes
+        $routes = require __DIR__ . '/../app/routes.php';
+        $routes($app);
+
+        return $app;
+    }
+
+    /**
+     * @param string $method
+     * @param string $path
+     * @param array  $headers
+     * @param array  $cookies
+     * @param array  $serverParams
+     * @return Request
+     */
+    protected function createRequest(
+        string $method,
+        string $path,
+        array $headers = ['HTTP_ACCEPT' => 'application/json'],
+        array $cookies = [],
+        array $serverParams = []
+    ): Request {
+        $uri = new Uri('', '', 80, $path);
+        $handle = fopen('php://temp', 'w+');
+        $stream = (new StreamFactory())->createStreamFromResource($handle);
+
+        $h = new Headers();
+        foreach ($headers as $name => $value) {
+            $h->addHeader($name, $value);
+        }
+
+        return new SlimRequest($method, $uri, $h, $cookies, $serverParams, $stream);
+    }
+}
diff --git a/tests/bootstrap.php b/tests/bootstrap.php
new file mode 100644
index 0000000..d21c14d
--- /dev/null
+++ b/tests/bootstrap.php
@@ -0,0 +1,3 @@
+<?php
+
+require __DIR__ . '/../vendor/autoload.php';